
CAS Number452-64-2
Synonyms4-Fluoro-1,2-dimethylbenzene; 3,4-Dimethylfluorobenzene; 4-Fluoro-o-xylene; 4-fluoro-1,2-xylene; 1,2-Dimethyl-4-fluorobenzene; MFCD00039217; 1,2-Dimethyl-4-fluoro benzene
Molecular FormulaC8H9F
Molecular Weight124.156
Purity98%
Density1.0±0.1 g/cm3
Boiling Point151.7±9.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 452-64-2 |
| Catalog No. | 2A-9005729 |
| Chinese Name | 4-氟邻二甲苯 |
| Synonyms | 4-Fluoro-1,2-dimethylbenzene; 3,4-Dimethylfluorobenzene; 4-Fluoro-o-xylene; 4-fluoro-1,2-xylene; 1,2-Dimethyl-4-fluorobenzene; MFCD00039217; 1,2-Dimethyl-4-fluoro benzene |
| Molecular Formula | C8H9F |
| Molecular Weight | 124.156 |
| Purity | 98 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 151.7±9.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| Packaging | III |
| HTC | 2903999090 |
| SMILES | Cc1ccc(F)cc1C |
| InChI | InChI=1S/C8H9F/c1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3 |
| InChI Key | WYHBENDEZDFJNU-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/5729_1_452_64_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified 4-Fluoro-o-xylene Modification number: 5 Module 14. Shipping information Packing grade: III |
| Related Products in Industrial Applications | ||
|---|---|---|
| 4-Chloro-2-fluorotoluene | 452-75-5 | 2A-9005576 |
| 4-Chloro-3-fluorotoluene | 5527-94-6 | 2A-9005599 |
| 4-Chlorobenzenesulphonylacetone | 5000-48-6 | 2A-9005643 |
| 4-Chlorodiphenylmethanol | 119-56-2 | 2A-9005658 |
| 4-Ethylphenylacetone | 75251-24-0 | 2A-9005727 |
| 4-Fluoro-2-iodotoluene | 13194-67-7 | 2A-9005732 |
| 4-Fluoro-2-nitrotoluene | 446-10-6 | 2A-9005743 |
| 4-Fluoro-3-iodotoluene | 452-82-4 | 2A-9005749 |
| 4-Fluoro-3-nitrotoluene | 446-11-7 | 2A-9005766 |
| 4-Hydroxy-3-methoxyphenylacetone | 2503-46-0 | 2A-9005847 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA