CAS Number371766-08-4
SynonymsIsoquinoline-5-boronicacid; 5-Isoquinolinylboronic acid; isoquinolin-5-ylboronic acid; MFCD03839356
Molecular FormulaC9H8O2N1B1
Molecular Weight172.98
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point419.1±37.0 °C at 760 mmHg
Melting Point166-188ºC
Appearancewhite to brown powder, crystals powder, crystals, solid, and/or lumps
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 371766-08-4 |
| Catalog No. | 2A-9056883 |
| Chinese Name | 异喹啉-5-硼酸 |
| Synonyms | Isoquinoline-5-boronicacid; 5-Isoquinolinylboronic acid; isoquinolin-5-ylboronic acid; MFCD03839356 |
| Molecular Formula | C9H8O2N1B1 |
| Molecular Weight | 172.98 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 419.1±37.0 °C at 760 mmHg |
| Melting Point | 166-188ºC |
| Appearance | white to brown powder, crystals powder, crystals, solid, and/or lumps |
| Storage Condition | Keep Cold |
| HTC | 2933499090 |
| MDL Number | MFCD03839356 |
| SMILES | OB(O)c1cccc2cnccc12 |
| InChI | InChI=1S/C9H8BNO2/c12-10(13)9-3-1-2-7-6-11-5-4-8(7)9/h1-6,12-13H |
| InChI Key | XKEYHBLSCGBBGU-UHFFFAOYSA-N |
| MSDS | msds/56883_1_371766_08_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4'-Chloro-4-biphenylboronic acid | 364044-44-0 | 2A-9056837 |
| 4'-(Trifluoromethyl)-4-biphenylboronic acid | 364590-93-2 | 2A-9056839 |
| (5-Bromomethylpyrazin-2-yl)carbamic acid tert-butyl ester | 369638-69-7 | 2A-9056868 |
| 2-Methoxy-5-pyridineboronic acid hydrochloride | 370864-57-6 | 2A-9056876 |
| Quinoline-4-boronic acid | 371764-64-6 | 2A-9056882 |
| 5-Methyl-2-pyridineboronic acid | 372963-49-0 | 2A-9056894 |
| 2-(tert-Butoxymethyl)phenylboronic acid | 373384-12-4 | 2A-9056895 |
| 3-(Methylsulfonyl)phenylboronic acid | 373384-18-0 | 2A-9056897 |
| 2-(2-Carboxyvinyl)benzeneboronic acid | 374105-86-9 | 2A-9056905 |
| 4-Fluoro-3-formylphenylboronic acid | 374538-01-9 | 2A-9056908 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS