
CAS Number333432-28-3
Synonyms9,9-Dimethylfluoren-2-boronic acid; 9,9-Dimethyl-9H-fluorene-2-yl-2-boronic acid; 9,9-dimethyl-9H-fluorene-2-yl-boronic acid; 2-(9,9-dimethylfluorenyl)boronic acid; (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid; 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid; 9,9-dimethylfluoren-2-ylboronic acid; 9,9-dimethyl-2-fluorene boronic acid; 9,9-dimethyl-9H-fluoren-2-ylboronic acid
Molecular FormulaC15H15BO2
Molecular Weight238.09
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point436.5±48.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 333432-28-3 |
| Catalog No. | 2A-9056634 |
| Chinese Name | 9,9-二甲基芴-2-硼酸 |
| Synonyms | 9,9-Dimethylfluoren-2-boronic acid; 9,9-Dimethyl-9H-fluorene-2-yl-2-boronic acid; 9,9-dimethyl-9H-fluorene-2-yl-boronic acid; 2-(9,9-dimethylfluorenyl)boronic acid; (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid; 9,9-Dimethyl-9H-fluoren-2-yl-boronic acid; 9,9-dimethylfluoren-2-ylboronic acid; 9,9-dimethyl-2-fluorene boronic acid; 9,9-dimethyl-9H-fluoren-2-ylboronic acid |
| Molecular Formula | C15H15BO2 |
| Molecular Weight | 238.09 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 436.5±48.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | room temperature |
| HTC | 2931900090 |
| PubChem ID | 329774372 |
| MDL Number | MFCD08704227 |
| SMILES | OB(O)C1=CC2=C(C=C1)C3=C(C=CC=C3)C2(C)C |
| InChI | 1S/C15H15BO2/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16(17)18)9-14(12)15/h3-9,17-18H,1-2H3 |
| InChI Key | DMDPAJOXRYGXCB-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/56634_1_333432_28_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 9,9-Dimethylfluorene-2-boronic acid (containing varying amounts of anhydride) Modification number: 5 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(N-Boc-amino)phenylboronic acid pinacol ester | 330793-01-6 | 2A-9056617 |
| 2-(Methanesulfonyl)phenylboronic acid | 330804-03-0 | 2A-9056618 |
| 3-(Chlorocarbonylphenyl)boronic anhydride | 332154-58-2 | 2A-9056628 |
| 3,3-Dimethoxycyclobutanecarboxylic acid | 332187-56-1 | 2A-9056629 |
| 2-(3-Fluorophenyl)-4-thiazolidinecarboxylic acid | 333408-47-2 | 2A-9056633 |
| 4-Benzyloxy-3,5-dimethylphenylboronic acid | 333788-94-6 | 2A-9056636 |
| (10-Phenylanthracen-9-yl)boronic acid | 334658-75-2 | 2A-9056643 |
| Methyl 3-bromo-2-bromomethylbenzoate | 337536-14-8 | 2A-9056670 |
| 1H-Indazole-5-boronic acid | 338454-14-1 | 2A-9056674 |
| 4-Benzyloxy-3-methylphenylboronic acid | 338454-30-1 | 2A-9056675 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA