CAS Number329014-60-0
Synonyms2,3-Difluoro-p-anisic acid; MFCD03428569; 2,3-difluoro-4-methoxy-benzoic Acid; 2,3-Difluoro-4-methoxybenzoic acid; QVR BF CF DO1
Molecular FormulaC8H6O3F2
Molecular Weight188.13
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point267.8±35.0 °C at 760 mmHg
Melting Point222-224°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 329014-60-0 |
| Catalog No. | 2A-9056600 |
| Chinese Name | 2,3-二氟-4-甲氧基苯甲酸 |
| Synonyms | 2,3-Difluoro-p-anisic acid; MFCD03428569; 2,3-difluoro-4-methoxy-benzoic Acid; 2,3-Difluoro-4-methoxybenzoic acid; QVR BF CF DO1 |
| Molecular Formula | C8H6O3F2 |
| Molecular Weight | 188.13 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 267.8±35.0 °C at 760 mmHg |
| Melting Point | 222-224°C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2918990090 |
| MDL Number | MFCD03428569 |
| SMILES | COc1ccc(C(O)=O)c(F)c1F |
| InChI | InChI=1S/C8H6F2O3/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3H,1H3,(H,11,12) |
| InChI Key | InChIKey=OBSJPUVORWCLNA-UHFFFAOYSA-N |
| MSDS | msds/56600_1_329014_60_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Lensiprazine | 327026-93-7 | 2A-9056580 |
| 3-Chloro-5-fluorobenzonitrile | 327056-73-5 | 2A-9056584 |
| 3-Cyano-5-fluorobenzoic acid | 327056-74-6 | 2A-9056585 |
| 2-[2-[2-Chloro-3-[(1,3-dihydro-1,3,3-trimethyl-5-sulfo-2H-indol-2-ylidene)ethylidene]-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-5-sulfo-3H-indolium inner salt sodium salt | 328064-20-6 | 2A-9056588 |
| Tildipirosin | 328898-40-4 | 2A-9056595 |
| N-Methyl-N-[2-(4-nitrophenoxy)ethyl]-2-pyridinamine | 329249-47-0 | 2A-9056604 |
| 2-Amino-5-[[4-[2-(methyl-2-pyridinylamino)ethoxy]phenyl]methyl]-4(5H)-thiazolone | 329249-53-8 | 2A-9056605 |
| n-Butylcyclopentadienylzirconium trichloride | 329735-75-3 | 2A-9056606 |
| O-(6-Chlorobenzotriazol-1-yl)-N,N,N',N'-tetramethyluronium tetrafluoroborate | 330641-16-2 | 2A-9056614 |
| 5-Chloro-1-[bis(dimethylamino)methylene]-1H-benzotriazolium 3-oxide hexafluorophosphate | 330645-87-9 | 2A-9056615 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS