
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 831-81-2 |
| Catalog No. | 2A-9005657 |
| Chinese Name | 4-氯二苯基甲烷 |
| Synonyms | 1-benzyl-4-chlorobenzene; 4-CHLORODIPHENYL METHANE; p-Chlorobenzylbenzene; MFCD00094070; (4-benzyl)chlorobenzene |
| Molecular Formula | C13H11Cl |
| Molecular Weight | 202.67900 |
| Purity | 98 |
| Density | 1,11 g/cm3 |
| Boiling Point | 147-148°C 8mm |
| Melting Point | 7 °C |
| Storage Condition | Packed in plastic barrels and stored in a cool, ve |
| HTC | 2903999090 |
| SMILES | Clc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11Cl/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChI Key | NPOGRKGIBGKRNI-UHFFFAOYSA-N |
| MSDS | msds/5657_1_831_81_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-Chlorodiphenylmethane Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chlorobenzylamine | 104-86-9 | 2A-9005649 |
| 4-Chlorobutyronitrile | 628-20-6 | 2A-9005652 |
| 4-Chlorocatechol | 2138-22-9 | 2A-9005653 |
| 4-Chlorocinnamic acid | 1615-02-7 | 2A-9005654 |
| 4-Chlorodiphenyl ether | 7005-72-3 | 2A-9005656 |
| 4-Chloro-D-phenylalanine | 14091-08-8 | 2A-9005659 |
| 4-Chloroiodobenzene | 637-87-6 | 2A-9005662 |
| 4-Chloromandelic acid | 492-86-4 | 2A-9005664 |
| 4-Chloro-N-(2-oxo-tetrahydrothiophen-3-yl)benzamide | 2A-105672 | 2A-9005672 |
| 4-Chloro-N-(4-methoxybenzyl)-2-(trifluoroacetyl)aniline | 173676-54-5 | 2A-9005673 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA