CAS Number313222-85-4
SynonymsNatriumphenoxyacetat; MFCD00064234; Phenoxy acetic acid sodium; Sodium phenoxyacetate; EINECS 222-746-8; PHENOXYACETIC ACID,SODIUM SALT HYDRATE; PHENOXYACETIC ACID SODIUM SALT HEMIHYDRATE; sodiuM 2-phenoxyacetate hydrate; Acetic acid, 2-phenoxy-, sodium salt (1:1); Phenoxyacetic acid hydrate sodium salt
Molecular FormulaC8H7NaO3
Molecular Weight218.14
Purity98.00%
Melting Point170-175 °C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 313222-85-4 |
| Catalog No. | 2A-9056494 |
| Chinese Name | 苯氧乙酸钠 |
| Synonyms | Natriumphenoxyacetat; MFCD00064234; Phenoxy acetic acid sodium; Sodium phenoxyacetate; EINECS 222-746-8; PHENOXYACETIC ACID,SODIUM SALT HYDRATE; PHENOXYACETIC ACID SODIUM SALT HEMIHYDRATE; sodiuM 2-phenoxyacetate hydrate; Acetic acid, 2-phenoxy-, sodium salt (1:1); Phenoxyacetic acid hydrate sodium salt |
| Molecular Formula | C8H7NaO3 |
| Molecular Weight | 218.14 |
| Purity | 98.00 |
| Melting Point | 170-175 °C |
| Appearance | powder |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2918990090 |
| MDL Number | MFCD00064210 |
| SMILES | [Na+].[O-]C(=O)C(O)C(O)C(O)C(O)CO |
| InChI | 1S/C6H12O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1 |
| InChI Key | UPMFZISCCZSDND-UHFFFAOYSA-M |
| NACRES Code | NA.22 |
| UNSPSC | 12352107 |
| MSDS | msds/56494_1_313222_85_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D-S-Isoamylcysteine | 312746-71-7 | 2A-9056486 |
| 5,6-Diethyl-2,3-dihydro-1H-inden-2-amine hydrochloride | 312753-53-0 | 2A-9056489 |
| (3Z)-4-[(2-Hydroxyethyl)amino]-3-penten-2-one | 312933-35-0 | 2A-9056490 |
| 1,2,3,4,5-Pentaphenyl-1'-(di-tert-butylphosphino)ferrocene | 312959-24-3 | 2A-9056491 |
| D-3-Phenylserine monohydrate | 313222-82-1 | 2A-9056493 |
| 4-(4-Propylcyclohexyl)benzonitrile | 313552-83-9 | 2A-9056500 |
| 7,8-Dichloroquinolin-5-amine | 314272-29-2 | 2A-9056506 |
| 2-Methyl-4-(2-methylbenzoylamino)benzoic acid | 317374-08-6 | 2A-9056525 |
| 4-(1-Benzylpiperidin-4-yl)butan-1-ol | 318508-02-0 | 2A-9056534 |
| 2-Bromo-7-iodo-9,9-dimethylfluorene | 319906-45-1 | 2A-9056538 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS