
CAS Number282524-82-7
Synonyms3-amino-4,4-dimethyl-pentanoic acid; 3-Amino-3-[4-(tert-butyl)phenyl]propanoic acid; (RS)-3-amino-3-(4-tert-butylphenyl)propionic acid; aminobutylphenylpropanoicacid; RARECHEM AK HD C009
Molecular FormulaC13H19NO2
Molecular Weight206.28
Purity98.00%
Density1.082g/cm3
Boiling Point352.2ºC at 760mmHg
Melting Point240-242ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 282524-82-7 |
| Catalog No. | 2A-9056285 |
| Chinese Name | 3-氨基-3-(4-叔丁基苯基)丙酸 |
| Synonyms | 3-amino-4,4-dimethyl-pentanoic acid; 3-Amino-3-[4-(tert-butyl)phenyl]propanoic acid; (RS)-3-amino-3-(4-tert-butylphenyl)propionic acid; aminobutylphenylpropanoicacid; RARECHEM AK HD C009 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 206.28 |
| Purity | 98.00 |
| Density | 1.082g/cm3 |
| Boiling Point | 352.2ºC at 760mmHg |
| Melting Point | 240-242ºC |
| Appearance | solid |
| HTC | 2922499990 |
| PubChem ID | 329818864 |
| MDL Number | MFCD00796482 |
| SMILES | OC(=O)CCc1ccc(cc1)C(C)(C)C |
| InChI | 1S/C13H18O2/c1-13(2,3)11-7-4-10(5-8-11)6-9-12(14)15/h4-5,7-8H,6,9H2,1-3H3,(H,14,15) |
| InChI Key | BNJYANVQFVSYEK-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/56285_1_282524_82_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | P. Quarantine of entry animals, plants, and animal and plant products Q. Quarantine of exit animals, plants, and animal and plant products R. Hygiene supervision and inspection of imported food S. Hyg |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 21-Aminoepothilone B | 280578-49-6 | 2A-9056276 |
| Tulathromycin B | 280755-12-6 | 2A-9056278 |
| Methyl 4-(piperidin-4-yl)benzoate | 281235-04-9 | 2A-9056282 |
| 4-[trans-4-(trans-4-Methylcyclohexyl)cyclohexyl]-1-trifluoromethoxybenzene | 281680-32-8 | 2A-9056283 |
| 1,3-Bis(2,6-diisopropylphenyl)-4,5-dihydroimidazolium tetrafluoroborate | 282109-83-5 | 2A-9056284 |
| Cetilistat | 282526-98-1 | 2A-9056286 |
| (5R,6S)-5,6-Diphenyl-2-morpholinone | 282735-66-4 | 2A-9056288 |
| (3S)-3-(9H-Fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[tri(phenyl)methylamino]pentanoic acid | 283160-20-3 | 2A-9056290 |
| 5-Fluoro-3-hydrazonoindolin-2-one | 283584-52-1 | 2A-9056292 |
| Denibulin | 284019-34-7 | 2A-9056293 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA