
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 272442-14-5 |
| Catalog No. | 2A-9056242 |
| Chinese Name | 十六烷酸-9,9-D2 |
| Synonyms | (9,9-H)Hexadecanoic acid; Hexadecanoic-9,9-d acid |
| Molecular Formula | 13CH3(CH213CH2)6CH213CD2CO2Na |
| Molecular Weight | 288.36 |
| Purity | ≥98 (CP) |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 340.6±5.0 °C at 760 mmHg |
| Appearance | flakes |
| Application | Palmitic acid-d2-2 is deuterium labeled palmitic acid. Palmitic acid is a long-chain saturated fatty acid commonly found in animals and plants. PA can induce the expression of glucose-regulated protei |
| SMILES | [13CH3]C[13CH2]C[13CH2]C[13CH2]C[13CH2]C[13CH2]C[13CH2]C[13C]([2H])([2H])C(O[Na])=O |
| UNSPSC | 12142201 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 4-cyano-3-fluorobenzoate | 268734-34-5 | 2A-9056181 |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-aspartic acid 4-[[4-[[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl]amino]phenyl]methyl] ester | 269066-08-2 | 2A-9056183 |
| 2-[2-[3-[2-(1,3-Dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)ethylidene]-2-(phenylthio)-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-3H-indolium chloride | 269401-43-6 | 2A-9056197 |
| Dimefluthrin | 271241-14-6 | 2A-9056240 |
| Disitertide | 272105-42-7 | 2A-9056241 |
| Fluo 4AM | 273221-67-3 | 2A-9056246 |
| 1-(6-Chloro-1H-benzimidazol-2-yl)methanamine | 273399-95-4 | 2A-9056247 |
| D-4-tetr-Butylphenylalanine | 274262-82-7 | 2A-9056248 |
| 3-tert-Butyl-9,10-di(naphth-2-yl)anthracene | 274905-73-6 | 2A-9056251 |
| 1-Phenylmethyl-L-histidine methyl ester monohydrochloride | 274927-61-6 | 2A-9056252 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA