
CAS Number270062-87-8
SynonymsBenzenebutanoic acid, β-amino-4-nitro-, (βS)-, hydrochloride (1:1); (3S)-3-Amino-4-(4-nitrophenyl)butanoic acid hydrochloride; MFCD01861017; (3S)-3-Amino-4-(4-nitrophenyl)butanoic acid hydrochloride (1:1)
Molecular FormulaC10H12N2O4
Molecular Weight196.63
Purity98.00%
Boiling Point430.2ºC at 760mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 270062-87-8 |
| Catalog No. | 2A-9056208 |
| Chinese Name | (S)-3-氨基-4-(4-硝基苯基)-丁酸盐酸盐 |
| Synonyms | Benzenebutanoic acid, β-amino-4-nitro-, (βS)-, hydrochloride (1:1); (3S)-3-Amino-4-(4-nitrophenyl)butanoic acid hydrochloride; MFCD01861017; (3S)-3-Amino-4-(4-nitrophenyl)butanoic acid hydrochloride (1:1) |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 196.63 |
| Purity | 98.00 |
| Boiling Point | 430.2ºC at 760mmHg |
| Appearance | powder |
| Storage Condition | room temperature |
| HTC | 2922499990 |
| PubChem ID | 24891130 |
| MDL Number | MFCD00043020 |
| SMILES | Cl[H].NCCO\C=C\[C@H](N)C(O)=O |
| InChI | 1S/C6H12N2O3.ClH/c7-2-4-11-3-1-5(8)6(9)10;/h1,3,5H,2,4,7-8H2,(H,9,10);1H/b3-1+;/t5-;/m0./s1 |
| InChI Key | ZDCPLYVEFATMJF-BTIOQYSDSA-N |
| Beilstein/REAXYS | 6715149 |
| NACRES Code | NA.72 |
| UNSPSC | 10171502 |
| MSDS | msds/56208_1_270062_87_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | P. Quarantine of entry animals, plants, and animal and plant products Q. Quarantine of exit animals, plants, and animal and plant products R. Hygiene supervision and inspection of imported food S. Hyg |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-3-Amino-4-(2-naphthyl)butyric acid hydrochloride | 269398-90-5 | 2A-9056196 |
| Fmoc-(S)-3-Amino-4-(4-fluorophenyl)butyric acid | 270062-83-4 | 2A-9056204 |
| (S)-3-Amino-4-(4-bromophenyl)butyric acid hydrochloride | 270062-84-5 | 2A-9056205 |
| Boc-(S)-3-Amino-4-(4-bromophenyl)butyric acid | 270062-85-6 | 2A-9056206 |
| Fmoc-(S)-3-Amino-4-(4-bromophenyl)butyric acid | 270062-86-7 | 2A-9056207 |
| Fmoc-(S)-3-Amino-4-(4-nitrophenyl)butyric acid | 270062-88-9 | 2A-9056209 |
| (S)-3-Amino-4-(2-methylphenyl)butyric acid hydrochloride | 270062-89-0 | 2A-9056210 |
| Boc-(S)-3-Amino-4-(2-methylphenyl)butanoic acid | 270062-90-3 | 2A-9056211 |
| Fmoc-(S)-3-Amino-4-(2-methylphenyl)butanoic acid | 270062-91-4 | 2A-9056212 |
| (S)-3-Amino-4-(3-methylphenyl)butyric acid hydrochloride | 270062-92-5 | 2A-9056213 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA