
CAS Number269398-87-0
Synonyms(3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenylpentanoic acid; (R)-3-(Fmoc-amino)-5-phenylpentanoicacid; Fmoc-D-beta-Nva(5-phenyl)-OH; FMOC-D-PHE(NO CH2,C*CH2)-OH; MFCD01860931; N-(9-FLUORENYLMETHOXYCARBONYL)-(R)-3-AMINO-5-PHENYLPENTANOIC ACID; Fmoc-D-b-Nva(5-phenyl)-OH; RARECHEM AK PT F054; FMOC-D-HPH-(C*CH2)OH
Molecular FormulaC26H25NO4
Molecular Weight415.481
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point657.5±55.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 269398-87-0 |
| Catalog No. | 2A-9056194 |
| Chinese Name | (R)-3-((((9H-芴-9-基)甲氧基)羰基)氨基)-5-苯基戊酸 |
| Synonyms | (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenylpentanoic acid; (R)-3-(Fmoc-amino)-5-phenylpentanoicacid; Fmoc-D-beta-Nva(5-phenyl)-OH; FMOC-D-PHE(NO CH2,C*CH2)-OH; MFCD01860931; N-(9-FLUORENYLMETHOXYCARBONYL)-(R)-3-AMINO-5-PHENYLPENTANOIC ACID; Fmoc-D-b-Nva(5-phenyl)-OH; RARECHEM AK PT F054; FMOC-D-HPH-(C*CH2)OH |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.481 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 657.5±55.0 °C at 760 mmHg |
| Storage Condition | Store in a sealed container filled with inert gas |
| HTC | 2924299090 |
| SMILES | O=C(O)CC(CCc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI Key | FYJRCXFXXJMPFO-LJQANCHMSA-N |
| MSDS | msds/56194_1_269398_87_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| Fmoc-(R)-3-Amino-4-(2-methylphenyl)butanoic acid | 269398-81-4 | 2A-9056189 |
| (R)-3-Amino-4-(3-methylphenyl)butyric acid hydrochloride | 269398-82-5 | 2A-9056190 |
| Fmoc-(R)-3-Amino-4-(3-methylphenyl)butyric acid | 269398-84-7 | 2A-9056191 |
| Boc-(R)-3-Amino-4-(4-methylphenyl)butyric acid | 269398-85-8 | 2A-9056192 |
| Fmoc-(R)-3-Amino-4-(4-methylphenyl)butanoic acid | 269398-86-9 | 2A-9056193 |
| (R)-3-Amino-4-(1-naphthyl)butyric acid hydrochloride | 269398-88-1 | 2A-9056195 |
| (R)-3-Amino-4-(2-naphthyl)butyric acid hydrochloride | 269398-90-5 | 2A-9056196 |
| Fmoc-(S)-3-Amino-4-(4-fluorophenyl)butyric acid | 270062-83-4 | 2A-9056204 |
| (S)-3-Amino-4-(4-bromophenyl)butyric acid hydrochloride | 270062-84-5 | 2A-9056205 |
| Boc-(S)-3-Amino-4-(4-bromophenyl)butyric acid | 270062-85-6 | 2A-9056206 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA