
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 257933-82-7 |
| Catalog No. | 2A-9056069 |
| Chinese Name | 培利替尼 |
| Synonyms | pelitinib; WAY-EKB 569; EKB-569 |
| Molecular Formula | C24H23O2N5Cl1F1 |
| Molecular Weight | 467.93 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 655.5±55.0 °C at 760 mmHg |
| Melting Point | 173-178ºC |
| Appearance | off-white solid |
| Water Solubility | DMSO: soluble5mg/mL, clear (warmed) |
| Storage Condition | -20°C Freezer |
| Packaging | III |
| Application | Pelitinib (EKB-569; WAY-EKB 569) is a reversible EGFR inhibitor with an IC50 value of 38.5 nM. It can also slightly inhibit Src, MEK/ERK and ErbB2, with IC50 values of 282, 800, and 1255 nM respecti |
| MDL Number | MFCD09837868 |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C=CCN(C)C |
| InChI | InChI=1S/C24H23ClFN5O2/c1-4-33-22-12-20-17(11-21(22)30-23(32)6-5-9-31(2)3)24(15(13-27)14-28-20)29-16-7-8-19(26)18(25)10-16/h5-8,10-12,14H,4,9H2,1-3H3,(H,28,29)(H,30,32)/b6-5+ |
| InChI Key | WVUNYSQLFKLYNI-AATRIKPKSA-N |
| MSDS | msds/56069_1_257933_82_7.pdf |
| Transport Info | Product Name: Peritinib |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Camtobell | 256411-32-2 | 2A-9056057 |
| (E)-3-[2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-2-propenenitrile | 256431-72-8 | 2A-9056061 |
| 2-[2-[3-[2-(1,3-Dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)ethylidene]-2-(hexahydro-1,3-dimethyl-2,4,6-trioxo-5-pyrimidinyl)-1-cyclopenten-1-yl]ethenyl]-1,3,3-trimethyl-3H-indolium inner salt | 256520-09-9 | 2A-9056062 |
| (2-Ethyl-6-methylphenyl)diphenylamine | 256660-16-9 | 2A-9056064 |
| (1-Fluorovinyl)methyldiphenylsilane | 257610-49-4 | 2A-9056066 |
| 3-Cyano-4-isopropoxybenzoic acid | 258273-31-3 | 2A-9056073 |
| 3-Cyano-4-ethoxybenzoic acid | 258273-32-4 | 2A-9056074 |
| 2,5-Difluorophenacyl bromide | 258513-41-6 | 2A-9056079 |
| Larazotide | 258818-34-7 | 2A-9056080 |
| 2-Mercapto-2-methyl-1-pentanol | 258823-39-1 | 2A-9056081 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA