
CAS Number247569-42-2
SynonymsBenzenemethanamine,4-chloro-3-methoxy; 4-Chloro-3-methoxybenzylamine; 4-chloro-3-methoxybenzenemethanamine
Molecular Formula4-(Cl)-3-(CH3)C6H3OH
Molecular Weight142.58
Purity≥99.0 (GC)%
Density1.18 g/cm3
Boiling Point235-239 °C/1013 hPa
Melting Point63-65 °C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 247569-42-2 |
| Catalog No. | 2A-9055978 |
| Chinese Name | 4-氯-3-甲氧基苄胺 |
| Synonyms | Benzenemethanamine,4-chloro-3-methoxy; 4-Chloro-3-methoxybenzylamine; 4-chloro-3-methoxybenzenemethanamine |
| Molecular Formula | 4-(Cl)-3-(CH3)C6H3OH |
| Molecular Weight | 142.58 |
| Purity | ≥99.0 (GC) |
| Density | 1.18 g/cm3 |
| Boiling Point | 235-239 °C/1013 hPa |
| Melting Point | 63-65 °C |
| Appearance | powder |
| HTC | 2922299090 |
| MDL Number | MFCD00002323 |
| SMILES | Clc1c(cc(cc1)O)C |
| InChI | 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChI Key | CFKMVGJGLGKFKI-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352104 |
| MSDS | msds/55978_1_247569_42_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3,3-Trimethyl-2-((E)-2-(2-phenyl-3-[(E)-2-(1,3,3-trimethyl-1,3-dihydro-2H-indol-2-ylidene)ethylidene]-1-cyclohexen-1-yl)ethenyl)-3H-indolium tetrafluoroborate | 246517-73-7 | 2A-9055958 |
| Weinreb Linker | 247021-90-5 | 2A-9055963 |
| Dilopetine | 247046-52-2 | 2A-9055964 |
| 4-Morpholinophenylguanidine | 247234-41-9 | 2A-9055969 |
| Fimasartan | 247257-48-3 | 2A-9055970 |
| 2-(Dicyclohexylphosphino)biphenyl | 247940-06-3 | 2A-9055980 |
| 4''-Ethyl-2',3,4-trifluoro-1,1':4',1''-terphenyl | 248936-61-0 | 2A-9055983 |
| 2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate | 249561-98-6 | 2A-9055985 |
| 2-Methyl-2-adamantyl acrylate | 249562-06-9 | 2A-9055986 |
| Anamorelin | 249921-19-5 | 2A-9055987 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA