
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 223537-30-2 |
| Catalog No. | 2A-9055797 |
| Chinese Name | 芦平曲韦 |
| Synonyms | ag7088; UNII-RGE5K1Q5QW; Ruprintrivir; Rupintrivir |
| Molecular Formula | C31H39FN4O7 |
| Molecular Weight | 598.66 |
| Purity | ≥98 (HPLC) |
| Density | 1.213g/cm3 |
| Boiling Point | 866.7ºC at 760mmHg |
| Melting Point | 170-171°C |
| Appearance | powder |
| Storage Condition | room temperature |
| Application | Rupintrivirvr (AG7088), an antiviral agent, is a potent, selective and irreversible inhibitor of human rhinovirus (HRV) 3C protease. In H1-Hela and MRC-5 cell protection assays, Rupintrivirvr inhibite |
| SMILES | Fc1ccc(cc1)C[C@H](CC(=O)[C@@H](NC(=O)c3n[o]c(c3)C)C(C)C)C(=O)N[C@@H](C[C@@H]2CCNC2=O)\C=C\C(=O)OCC |
| InChI | 1S/C31H39FN4O7/c1-5-42-27(38)11-10-24(16-21-12-13-33-29(21)39)34-30(40)22(15-20-6-8-23(32)9-7-20)17-26(37)28(18(2)3)35-31(41)25-14-19(4)43-36-25/h6-11,14,18,21-22,24,28H,5,12-13,15-17H2,1-4H3,(H,33,39)(H,34,40)(H,35,41)/b11-10+/t21-,22+,24+,28-/m0/s1 |
| InChI Key | CAYJBRBGZBCZKO-BHGBQCOSSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/55797_1_223537_30_2.pdf |
| Transport Info | Product name: Rupintrivir |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-[(1S)-1-Aminoethyl]benzoic acid methyl ester | 222714-37-6 | 2A-9055787 |
| 4-(2-Aminopyrimidin-5-yl)benzoic acid | 222987-21-5 | 2A-9055788 |
| Inolitazone | 223132-37-4 | 2A-9055789 |
| 2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol | 223137-87-9 | 2A-9055790 |
| CP-533536 | 223488-57-1 | 2A-9055796 |
| 1-(4-Bromophenyl)-N-ethylmethanesulfonamide | 223555-84-8 | 2A-9055798 |
| 1-(4-Bromophenyl)-N-propylmethanesulfonamide | 223555-85-9 | 2A-9055799 |
| Garenoxacin mesylate hydrate | 223652-90-2 | 2A-9055803 |
| Angelica dahurica extract | 223747-83-9 | 2A-9055805 |
| Ganoderma lucidum extract | 223751-82-4 | 2A-9055806 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA