![2-Thiophenecarboxylic acid 2-(aminoiminomethyl)benzo[b]thien-6-yl ester structure, CAS 217099-43-9](/structures/60000/55656_3_217099_43_9.png)
CAS Number217099-43-9
Synonyms2-Carbamimidoyl-1-benzothiophen-6-yl 2-thiophenecarboxylate; 2-Thiophenecarboxylic acid, 2-(aminoiminomethyl)benzo[b]thien-6-yl ester; BCX 1470||BCX 1470|BCX-1470; BCX 1470; CS-0313; 2-carbamimidoyl-1-benzothiophen-6-yl thiophene-2-carboxylate; 2-Carbamimidoyl-1-benzothiophen-6-ylthiophen-2-carboxylat; cc-543
Molecular FormulaC14H10N2O2S2
Molecular Weight302.371
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point509.9±58.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 217099-43-9 |
| Catalog No. | 2A-9055656 |
| Chinese Name | BCX 1470 |
| Synonyms | 2-Carbamimidoyl-1-benzothiophen-6-yl 2-thiophenecarboxylate; 2-Thiophenecarboxylic acid, 2-(aminoiminomethyl)benzo[b]thien-6-yl ester; BCX 1470||BCX 1470|BCX-1470; BCX 1470; CS-0313; 2-carbamimidoyl-1-benzothiophen-6-yl thiophene-2-carboxylate; 2-Carbamimidoyl-1-benzothiophen-6-ylthiophen-2-carboxylat; cc-543 |
| Molecular Formula | C14H10N2O2S2 |
| Molecular Weight | 302.371 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 509.9±58.0 °C at 760 mmHg |
| Storage Condition | 2-8℃ |
| Application | BCX 1470 can inhibit the ester hydrolysis activity of factor D and C1s, with IC50 of 96 nM and 1.6 nM respectively. |
| SMILES | N=C(N)c1cc2ccc(OC(=O)c3cccs3)cc2s1 |
| InChI Key | OTGQTQBPQCRNRG-UHFFFAOYSA-N |
| Transport Info | Product name: BCX 1470 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Bromo-1,2,3,4-tetrahydroisoquinoline hydrochloride | 215798-19-9 | 2A-9055627 |
| 4-Methylisoxazole-3-carboxylic acid | 215872-46-1 | 2A-9055628 |
| tert-Butyl (3R)-3-(hydroxymethyl)morpholine-4-carboxylate | 215917-99-0 | 2A-9055629 |
| (3R)-1-(Phenylmethyl)-3-pyrrolidinecarboxylic acid | 216311-57-8 | 2A-9055637 |
| 5-Bromo-6-chloropyridine-3-sulfonyl chloride | 216394-05-7 | 2A-9055641 |
| 2-Thiophenecarboxylic acid 2-(aminoiminomethyl)benzo[b]thiophen-6-yl ester methanesulfonate (1:1) | 217099-44-0 | 2A-9055657 |
| 3-(Cyanomethyl)-1H-indole-1-carboxylic acid tert-butyl ester | 218772-62-4 | 2A-9055682 |
| 2-Methoxy-4-(trifluoromethyl)pyridine | 219715-34-1 | 2A-9055697 |
| 4-Allyl-2-chloropyridine | 219727-28-3 | 2A-9055699 |
| 4-Bromoquinoline-6-carboxylic acid | 219763-87-8 | 2A-9055701 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA