
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 151239-47-3 |
| Catalog No. | 2A-9005440 |
| Chinese Name | 4-溴-3-甲氧基苯甲酮 |
| Synonyms | 4-Bromo-3'-methoxybenzophenone |
| Molecular Formula | C14H11BrO2 |
| Molecular Weight | 246.69 |
| Purity | 97 |
| Density | 1.401g/cm3 |
| Boiling Point | 396.8ºC at 760mmHg |
| Appearance | solid |
| HTC | 2914700090 |
| PubChem ID | 329784805 |
| MDL Number | MFCD01311567 |
| SMILES | COc1cccc(c1)C(=O)c2ccc(Cl)cc2 |
| InChI | 1S/C14H11ClO2/c1-17-13-4-2-3-11(9-13)14(16)10-5-7-12(15)8-6-10/h2-9H,1H3 |
| InChI Key | ITRZDZXWSBXUFZ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/5440_1_151239_47_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-3-fluorobenzoic acid | 153556-42-4 | 2A-9005432 |
| 4-Bromo-3-fluorobenzotrifluoride | 40161-54-4 | 2A-9005433 |
| 4-Bromo-3'-fluorobiphenyl | 40641-65-4 | 2A-9005434 |
| 4-Bromo-3-fluoronitrobenzene | 185331-69-5 | 2A-9005435 |
| 4-Bromo-3-fluorophenol | 121219-03-2 | 2A-9005436 |
| 4-Bromo-3'-methoxybiphenyl | 74447-69-1 | 2A-9005441 |
| 4-Bromo-3-methylaniline | 6933-10-4 | 2A-9005443 |
| 4-Bromo-3-methylanisole | 27060-75-9 | 2A-9005444 |
| 4-Bromo-3-methylbenzenesulphonyl chloride | 72256-93-0 | 2A-9005445 |
| 4-Bromo-3-methylbenzonitrile | 41963-20-6 | 2A-9005446 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA