
CAS Number66346-01-8
Synonymst-butyl-4-chlorophenethylketone; GR D2VX1&1&1; MFCD00270771; 4-diMethyl-3-pentanone; hwg1608-alkylketon; 1-(4-chlorphenyl)-4,4-dimethylpentan-3-on; 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone; 1-(4-Chlorophenyl)-4,4-dimethylpentan-3-one
Molecular FormulaC13H17O1Cl1
Molecular Weight224.73
Purity99%
Density1.1±0.1 g/cm3
Boiling Point297.4±15.0 °C at 760 mmHg
Melting Point18ºC
AppearanceLight yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 66346-01-8 |
| Catalog No. | 2A-9000540 |
| Chinese Name | 1-(4-氯苯基)-4,4-二甲基-3-戊酮 |
| Synonyms | t-butyl-4-chlorophenethylketone; GR D2VX1&1&1; MFCD00270771; 4-diMethyl-3-pentanone; hwg1608-alkylketon; 1-(4-chlorphenyl)-4,4-dimethylpentan-3-on; 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone; 1-(4-Chlorophenyl)-4,4-dimethylpentan-3-one |
| Molecular Formula | C13H17O1Cl1 |
| Molecular Weight | 224.73 |
| Purity | 99 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 297.4±15.0 °C at 760 mmHg |
| Melting Point | 18ºC |
| Appearance | Light yellow liquid |
| Storage Condition | 2-8 °C |
| HTC | 2914700090 |
| MDL Number | MFCD00270771 |
| SMILES | CC(C)(C)C(=O)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClO/c1-13(2,3)12(15)9-6-10-4-7-11(14)8-5-10/h4-5,7-8H,6,9H2,1-3H3 |
| InChI Key | ILQGIJDYSLHIOX-UHFFFAOYSA-N |
| MSDS | msds/540_1_66346_01_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-Benzhydryl-piperazin-1-yl)-2-chloroethanone | 2A-100532 | 2A-9000532 |
| 1-(4-Bromobenzyl)-1-methoxy-3-phenylurea | 149281-92-5 | 2A-9000533 |
| 1-(4-Bromobenzyloxy)-2,5-difluorobenzene | 2A-100535 | 2A-9000535 |
| 1-(4-Bromophenyl)-2-pyrrolidinone | 7661-32-7 | 2A-9000536 |
| 1-(4-Chlorobutyryl)-2,4,6-trimethoxybenzene | 2A-100539 | 2A-9000539 |
| 1-(4-Chlorophenyl)biguanide hydrochloride | 4022-81-5 | 2A-9000541 |
| 1-(4-Chlorophenyl)cyclobutanecarbonitrile | 28049-61-8 | 2A-9000542 |
| 1-(4-Hydroxy-2-chlorophenyl)ethanone | 68301-59-7 | 2A-9000555 |
| 1-(4-Hydroxyphenyl)-2-thiourea | 1520-27-0 | 2A-9000558 |
| 1-(4-Isobutylphenyl)ethanone | 38861-78-8 | 2A-9000562 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA