
CAS Number1073-29-6
SynonymsMethyl (2-hydroxyphenyl) sulfide; 1-Hydroxy-2-(methylmercapto)benzene; (2-Hydroxy)thioanisole; 2-(Methylmercapto)phenol; QR BS1; 2-Hydroxythioanisole; 2-(Methylthio)phenol; EINECS 214-027-2; 2-(Methylsulfanyl)phenol; 2-methylsulfanylphenol; MFCD00002211
Molecular FormulaC7H8OS
Molecular Weight140.203
Purity97%
Density1.2±0.1 g/cm3
Boiling Point206.1±0.0 °C at 760 mmHg
Appearancecolorless liquid
EINECS214-027-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1073-29-6 |
| Catalog No. | 2A-9000054 |
| Chinese Name | 2-羟基茴香硫醚 |
| Synonyms | Methyl (2-hydroxyphenyl) sulfide; 1-Hydroxy-2-(methylmercapto)benzene; (2-Hydroxy)thioanisole; 2-(Methylmercapto)phenol; QR BS1; 2-Hydroxythioanisole; 2-(Methylthio)phenol; EINECS 214-027-2; 2-(Methylsulfanyl)phenol; 2-methylsulfanylphenol; MFCD00002211 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.203 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 206.1±0.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| EINECS | 214-027-2 |
| HTC | 2930909090 |
| SMILES | CSc1ccccc1O |
| InChI | InChI=1S/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| InChI Key | SOOARYARZPXNAL-UHFFFAOYSA-N |
| MSDS | msds/54_1_1073_29_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-(Methylthio)phenol Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2-Benzimidazolythio)acetic acid | 3042-00-0 | 2A-9000047 |
| (2-Bromo-3-thienyl)methylamine | 157664-47-6 | 2A-9000048 |
| (2-Bromoethyl)benzene | 103-63-9 | 2A-9000049 |
| (2-Formylaminothiazol-4-yl)-oxo-acetic acid ethyl ester | 64987-03-7 | 2A-9000052 |
| (2H)1,4-Benzothiazin-3(4H)-one | 5325-20-2 | 2A-9000053 |
| (2-Isocyanatoethyl)benzene | 1943-82-4 | 2A-9000055 |
| (2-Methyl-1,6-naphthyridin-3-yl)morpholinomethanone | 2A-100056 | 2A-9000056 |
| (2-Oxo-2,3-dihydrobenzo[1,4]oxazin-4-yl)acetic acid | 2A-100057 | 2A-9000057 |
| (2-Pyrimidylthio)acetic acid | 88768-45-0 | 2A-9000058 |
| (2S)-2-Aminobutyramide | 143164-46-9 | 2A-9000059 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA