
CAS Number875-51-4
Synonymsp-bromonitroaniline; 2-Nitro-4-bromoaniline; 4-Bromo-2-nitro-phenylamine; 1-amino-4-bromo-2-nitrobenzene; Aniline,4-bromo-2-nitro; p-Bromo-o-nitroaniline; ZR DE BNW; 4-Bromo-2-nitroaniline; 4-Bromo-2-nitrobenzeneamine; Benzenamine,4-bromo-2-nitro; 4-Bromo-2-nitrobenzenamine; 4-bromo-o-nitroaniline; 4-bromo-2-nitro-aniline; 4-bromo-2-nitrooaniline; MFCD00041312
Molecular FormulaC6H5BrN2O2
Molecular Weight217.02
Purity97%
Density1.8±0.1 g/cm3
Boiling Point308.7±22.0 °C at 760 mmHg
Melting Point110-113 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 875-51-4 |
| Catalog No. | 2A-9005372 |
| Chinese Name | 4-溴-2-硝基苯胺 |
| Synonyms | p-bromonitroaniline; 2-Nitro-4-bromoaniline; 4-Bromo-2-nitro-phenylamine; 1-amino-4-bromo-2-nitrobenzene; Aniline,4-bromo-2-nitro; p-Bromo-o-nitroaniline; ZR DE BNW; 4-Bromo-2-nitroaniline; 4-Bromo-2-nitrobenzeneamine; Benzenamine,4-bromo-2-nitro; 4-Bromo-2-nitrobenzenamine; 4-bromo-o-nitroaniline; 4-bromo-2-nitro-aniline; 4-bromo-2-nitrooaniline; MFCD00041312 |
| Molecular Formula | C6H5BrN2O2 |
| Molecular Weight | 217.02 |
| Purity | 97 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 308.7±22.0 °C at 760 mmHg |
| Melting Point | 110-113 °C (lit.) |
| Appearance | solid |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| HTC | 2921420090 |
| PubChem ID | 24883888 |
| MDL Number | MFCD00041312 |
| SMILES | Nc1ccc(Br)cc1[N+]([O-])=O |
| InChI | 1S/C6H5BrN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| InChI Key | ZCWBZRBJSPWUPG-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/5372_1_875_51_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-2-fluorophenylisocyanide | 730964-93-9 | 2A-9005361 |
| 4-Bromo-2-hydroxybenzoic acid | 1666-28-0 | 2A-9005364 |
| 4-Bromo-2-methylaniline | 583-75-5 | 2A-9005366 |
| 4-Bromo-2-methylanisole | 14804-31-0 | 2A-9005367 |
| 4-Bromo-2-methylbenzenesulphonyl chloride | 139937-37-4 | 2A-9005368 |
| 4-Bromo-2-nitrobenzoic acid | 99277-71-1 | 2A-9005373 |
| 4-Bromo-2-nitrophenol | 7693-52-9 | 2A-9005374 |
| 4-Bromo-3,3,4,4-tetrafluorobut-1-ene | 18599-22-9 | 2A-9005382 |
| 4-Bromo-3',3''-dichlorotrityl alcohol | 2A-105383 | 2A-9005383 |
| 4-Bromo-3',3''-difluorotrityl alcohol | 2A-105384 | 2A-9005384 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA