
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104197-13-9 |
| Catalog No. | 2A-9005314 |
| Chinese Name | 4-溴-2,6-二氟苯酚 |
| Synonyms | 2,6-Difluoro-4-bromophenol |
| Molecular Formula | C6H3O1Br1F2 |
| Molecular Weight | 208.99 |
| Purity | 97 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 180.2±35.0 °C at 760 mmHg |
| Melting Point | 50°C |
| Storage Condition | Sealed and stored in a cool, dry warehouse. Keep a |
| HTC | 2908199090 |
| MDL Number | MFCD00236213 |
| SMILES | Oc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C6H3BrF2O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| InChI Key | GPRPSJPFAAGLCA-UHFFFAOYSA-N |
| MSDS | msds/5314_1_104197_13_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-2,6-diethylaniline | 56746-19-1 | 2A-9005309 |
| 4-Bromo-2,6-difluoroaniline | 67567-26-4 | 2A-9005310 |
| 4-Bromo-2,6-difluoroanisole | 104197-14-0 | 2A-9005311 |
| 4-Bromo-2,6-difluorobenzoic acid | 183065-68-1 | 2A-9005312 |
| 4-Bromo-2,6-difluorobenzonitrile | 123843-67-4 | 2A-9005313 |
| 4-Bromo-2,6-dimethylaniline | 24596-19-8 | 2A-9005315 |
| 4-Bromo-2,6-dimethylanisole | 14804-38-7 | 2A-9005316 |
| 4-Bromo-2-chloro-6-fluoroanisole | 261762-34-9 | 2A-9005318 |
| 4-Bromo-2-chloro-6-fluorophenol | 161045-79-0 | 2A-9005319 |
| 4-Bromo-2-chloroaniline | 38762-41-3 | 2A-9005320 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA