
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 133220-86-7 |
| Catalog No. | 2A-9052279 |
| Chinese Name | 2-氯-4-氟肉桂酸 |
| Synonyms | MFCD00236027; 2-Chloro-4-fluorocinnamic acid |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.59400 |
| Purity | 98.00 |
| Density | 1.42g/cm3 |
| Boiling Point | 312.8ºC at 760mmHg |
| Melting Point | 245-247 °C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2916399090 |
| SMILES | O=C(O)C=Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C9H6ClFO2/c10-8-5-7(11)3-1-6(8)2-4-9(12)13/h1-5H,(H,12,13)/p-1/b4-2+ |
| InChI Key | RJCWBTRMWGOREZ-DUXPYHPUSA-N |
| MSDS | msds/52279_1_133220_86_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Darifenacin hydrobromide | 133099-07-7 | 2A-9052265 |
| 3-Trifluoromethoxyphenylhydrazine | 133115-55-6 | 2A-9052269 |
| 12-(Acetyloxy)-3,6-dihydroxy-7-oxocholan-24-oic acid methyl ester | 133181-56-3 | 2A-9052276 |
| 12-(Acetyloxy)-3,6,7-trihydroxycholan-24-oic acid methyl ester | 133181-57-4 | 2A-9052277 |
| Isopropylidene(3-methylcyclopentadienyl)(9-fluorenyl)zirconium dichloride | 133190-48-4 | 2A-9052278 |
| 3-Iodo-2-methylbenzoic acid | 133232-56-1 | 2A-9052280 |
| Landiolol | 133242-30-5 | 2A-9052283 |
| Lactacystin | 133343-34-7 | 2A-9052287 |
| Cbz-leucinyl-leucinyl-norleucinal | 133407-83-7 | 2A-9052290 |
| 2-Chloro-N-(2-chloro-4-methylpyridin-3-yl)nicotinamide | 133627-46-0 | 2A-9052299 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA