![N-[6-(Biotinamido)hexyl]-3'-(2'-pyridyldithio)propionamide structure, CAS 129179-83-5](/structures/60000/51946_1_129179_83_5.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 129179-83-5 |
| Catalog No. | 2A-9051946 |
| Chinese Name | 生物素-HPDP |
| Synonyms | Biotin HPDP; N-[6-(Biotinamido)hexyl]-3`-(2`-pyridyldithio)propionamide(Biotin-HPDP) |
| Molecular Formula | C24H37N5O3S3 |
| Molecular Weight | 539.78 |
| Purity | ≥95 (HPLC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 876.0±65.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20°C |
| Application | Biotin HPDP is a biochemical reagent that can be used as a biological material or organic compound for life science-related research. |
| MDL Number | MFCD00078541 |
| SMILES | S1[C@H]([C@H]3NC(=O)N[C@H]3C1)CCCCC(=O)NCCCCCCNC(=O)CCSSc2ncccc2 |
| InChI | 1S/C24H37N5O3S3/c30-20(10-4-3-9-19-23-18(17-33-19)28-24(32)29-23)25-13-6-1-2-7-14-26-21(31)12-16-34-35-22-11-5-8-15-27-22/h5,8,11,15,18-19,23H,1-4,6-7,9-10,12-14,16-17H2,(H,25,30)(H,26,31)(H2,28,29,32)/t18-,19-,23-/m0/s1 |
| InChI Key | QLPHBNRMJLFRGO-YDHSSHFGSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/51946_1_129179_83_5.pdf |
| Transport Info | Product name: Biotin-HPDP |
| Related Products in Biotechnology & Diagnostics | ||
|---|---|---|
| N-4-Boc-N-1-Cbz-2-piperazinecarboxylic acid | 126937-41-5 | 2A-9051783 |
| Fmoc-O-tert-butyl-D-serine | 128107-47-1 | 2A-9051874 |
| Boc-L-Homoarginine hydrochloride | 128719-65-3 | 2A-9051926 |
| Boc-3-(4-Biphenylyl)-D-alanine | 128779-47-5 | 2A-9051929 |
| Boc-L-pyroglutamic acid methyl ester | 128811-48-3 | 2A-9051933 |
| Fmoc-Pro-Pro-OH | 129223-22-9 | 2A-9051947 |
| Fmoc-L-phenylalaninol | 129397-83-7 | 2A-9051963 |
| L-Fmoc-Aspartic acid alpha-tert-butyl ester | 129460-09-9 | 2A-9051969 |
| Boc-L-Ala-nitrile | 130013-83-1 | 2A-9052007 |
| Ethyl 1-Boc-3-piperidinecarboxylate | 130250-54-3 | 2A-9052030 |
| Browse all Biotechnology & Diagnostics products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA