
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 125733-43-9 |
| Catalog No. | 2A-9051700 |
| Chinese Name | 3',4'-二氯-2,2,2-三氟苯乙酮 |
| Synonyms | 1-(3,4-dichlorophenyl)-2,2,2-trifluoroacetophenone; 3',4'-dichloro-2,2,2-trifluoroacetophenone |
| Molecular Formula | C8H3O1Cl2F3 |
| Molecular Weight | 243.01 |
| Purity | 98.00 |
| Density | 1.506 g/cm3 |
| Boiling Point | 269.2ºC at 760 mmHg |
| HTC | 2914700090 |
| MDL Number | MFCD01319995 |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI Key | YWBUNUGOMAFWHQ-UHFFFAOYSA-N |
| MSDS | msds/51700_1_125733_43_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Octyl-3,5-di-tert-butyl-4-hydroxy-hydrocinnamate | 125643-61-0 | 2A-9051689 |
| Diethylaminopropyne formate | 125678-52-6 | 2A-9051690 |
| N,N,N',N'-Tetramethyl-O-(3,4-dihydro-4-oxo-1,2,3-benzotriazin-3-yl)uronium tetrafluoroborate | 125700-69-8 | 2A-9051696 |
| 2-(2-Pyridon-1-yl)-1,1,3,3-tetramethyluronium tetrafluoroborate | 125700-71-2 | 2A-9051697 |
| 2-(5-Norborene-2,3-dicarboximido)-1,1,3,3-tetramethyluronium tetrafluoroborate | 125700-73-4 | 2A-9051698 |
| Octakis(dimethylsiloxy)-T8-silsequioxane | 125756-69-6 | 2A-9051701 |
| Tipelukast | 125961-82-2 | 2A-9051705 |
| 4'-Tolylbicyclohexyl-4-one | 125962-80-3 | 2A-9051706 |
| 2-Benzylidene isobutyryl acetanilide | 125971-57-5 | 2A-9051707 |
| 2-[2-(4-Fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide | 125971-58-6 | 2A-9051708 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA