
CAS Number111076-66-5
Synonyms4-Aminobenzo-15-crown-5 hydrochloride; 2,3,5,6,8,9,11,12-Octahydrobenzo[b][1,4,7,10,13]pentaoxacyclopentadecin-15-amine hydrochloride; 4-aminobenzo-15-crown-5-ether hydrochloride
Molecular FormulaC14H22O5N1Cl1
Molecular Weight319.79
Purity98%
Boiling Point464.4ºC at 760 mmHg
Melting Point228-230 °C(lit.)
AppearanceOff-white to light gray-brown powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 111076-66-5 |
| Catalog No. | 2A-9005168 |
| Chinese Name | 4'-氨基苯并-15-冠-5-醚盐酸盐 |
| Synonyms | 4-Aminobenzo-15-crown-5 hydrochloride; 2,3,5,6,8,9,11,12-Octahydrobenzo[b][1,4,7,10,13]pentaoxacyclopentadecin-15-amine hydrochloride; 4-aminobenzo-15-crown-5-ether hydrochloride |
| Molecular Formula | C14H22O5N1Cl1 |
| Molecular Weight | 319.79 |
| Purity | 98 |
| Boiling Point | 464.4ºC at 760 mmHg |
| Melting Point | 228-230 °C(lit.) |
| Appearance | Off-white to light gray-brown powder |
| Water Solubility | Soluble |
| Storage Condition | Sealed in a cool, dry environment at 0-6 ºC |
| HTC | 2932999099 |
| MDL Number | MFCD00143253 |
| SMILES | Cl.Nc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C14H21NO5/c15-12-1-2-13-14(11-12)20-10-8-18-6-4-16-3-5-17-7-9-19-13/h1-2,11H,3-10,15H2 |
| InChI Key | HZNFLCQAHYOUST-UHFFFAOYSA-N |
| MSDS | msds/5168_1_111076_66_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CISAPRIDE MONOHYDRATE | 81098-60-4 | 2A-9005155 |
| 4-Amino-5-methoxy-2-methyl-N-methylbenzenesulfonamide | 49564-57-0 | 2A-9005158 |
| 4-Aminobenzamidine dihydrochloride | 2498-50-2 | 2A-9005165 |
| 4-Aminobenzanilide | 17625-83-1 | 2A-9005166 |
| 4-Aminobenzenethiol | 1193-02-8 | 2A-9005167 |
| 4-Aminobenzofurazan | 767-63-5 | 2A-9005169 |
| 4-Aminobenzoic acid methyl ester | 619-45-4 | 2A-9005170 |
| 4-Aminobenzoic acid tert-butyl ester | 18144-47-3 | 2A-9005171 |
| 4-Aminobenzonitrile | 873-74-5 | 2A-9005172 |
| 4-Aminobenzyl alcohol | 623-04-1 | 2A-9005173 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA