
CAS Number124937-62-8
SynonymsMethyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate; Benzenepropanoic acid,2-methoxy-5-methyl-b-phenyl-,methyl ester; Benzenepropanoic acid, 2-methoxy-5-methyl-β-phenyl-, methyl ester
Molecular FormulaC18H20O3
Molecular Weight219.24
Purity98%
Density1.1±0.1 g/cm3
Boiling Point401.8±33.0 °C at 760 mmHg
Melting Point161-163 °C (lit.)
EINECS220-734-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 124937-62-8 |
| Catalog No. | 2A-9051658 |
| Chinese Name | 3-(2-甲氧基-5-甲基苯基)-3-苯基丙酸甲酯 |
| Synonyms | Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate; Benzenepropanoic acid,2-methoxy-5-methyl-b-phenyl-,methyl ester; Benzenepropanoic acid, 2-methoxy-5-methyl-β-phenyl-, methyl ester |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 219.24 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 401.8±33.0 °C at 760 mmHg |
| Melting Point | 161-163 °C (lit.) |
| Storage Condition | 2-8℃, dry |
| EINECS | 220-734-7 |
| HTC | 2918990090 |
| PubChem ID | 24846692 |
| MDL Number | MFCD00005618 |
| SMILES | COc1ccc2[nH]c(C)c(CC(O)=O)c2c1 |
| InChI | 1S/C12H13NO3/c1-7-9(6-12(14)15)10-5-8(16-2)3-4-11(10)13-7/h3-5,13H,6H2,1-2H3,(H,14,15) |
| InChI Key | TXWGINUZLBAKDF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/51658_1_124937_62_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Fluoro-5-iodobenzoic acid | 124700-41-0 | 2A-9051635 |
| Dodecyl 4-chloro-3-nitrobenzoate | 124809-77-4 | 2A-9051645 |
| Silane, [(1-methoxyethenyl)oxy]trimethyl- | 36850-80-3 | 2A-9051647 |
| 2-[3-[Bis(1-methylethyl)amino]-1-phenyl-propyl]-4-methyl-methoxybenzene fumarate | 124935-88-2 | 2A-9051652 |
| 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanol | 124936-75-0 | 2A-9051655 |
| 7-Bromo-1-indanone | 125114-77-4 | 2A-9051664 |
| Metconazole | 125116-23-6 | 2A-0201907 |
| 2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol | 125304-04-3 | 2A-9051671 |
| N-(4-Bromo-3-chloro-2-methylphenyl)acetamide | 125328-80-5 | 2A-9051674 |
| Bispyribac | 125401-75-4 | 2A-9051677 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA