
CAS Number124379-29-9
Synonyms(4S)-4-(3,4-Dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenone; (S)-4-(3,4-Dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one; L66 BVT&J ER CG DG &&S Form; 4-(3,4-Dichloro-phenyl)-3,4-dihydro-2H-naphthalen-1-one; (4S)-4-(3,4-Dichlorophenyl)-3,4-dihydronaphthalen-1(2H)-one
Molecular FormulaC21H20Cl2O
Molecular Weight359.299
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point403.0±45.0 °C at 760 mmHg
Melting Point84ºC
Appearancebrown solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 124379-29-9 |
| Catalog No. | 2A-9051621 |
| Chinese Name | 4-(3,4-二氯苯)-3,4-二氢-2H-萘-1-酮 |
| Synonyms | (4S)-4-(3,4-Dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenone; (S)-4-(3,4-Dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one; L66 BVT&J ER CG DG &&S Form; 4-(3,4-Dichloro-phenyl)-3,4-dihydro-2H-naphthalen-1-one; (4S)-4-(3,4-Dichlorophenyl)-3,4-dihydronaphthalen-1(2H)-one |
| Molecular Formula | C21H20Cl2O |
| Molecular Weight | 359.299 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 403.0±45.0 °C at 760 mmHg |
| Melting Point | 84ºC |
| Appearance | brown solid |
| HTC | 2914700090 |
| MDL Number | MFCD03419200 |
| SMILES | O=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI Key | JGMBHJNMQVKDMW-NSHDSACASA-N |
| MSDS | msds/51621_1_124379_29_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 2-(N-benzoylaminomethyl)-3-oxobutyrate | 124044-11-7 | 2A-9051611 |
| D-Homophenylalanine ethyl ester | 124044-66-2 | 2A-9051613 |
| 4-Aminobenzoyl-Gly-Pro-D-Leu-D-Ala hydroxamic acid | 124168-73-6 | 2A-9051617 |
| (1-Benzylpiperidin-3-yl)methanamine | 124257-62-1 | 2A-9051619 |
| 4-(3,4-Dichlorophenyl)-2-hydroxy-3,4-dihydro-2H-naphthalen-1-one | 124345-10-4 | 2A-9051620 |
| 5(6)-Carboxyfluorescein diacetate | 124387-19-5 | 2A-9051622 |
| 4-[2-(Triethoxysilyl)vinyl]benzocyclobutene | 124389-79-3 | 2A-9051623 |
| N-Phenyl-isobutyloylacetamide | 124401-38-3 | 2A-9051624 |
| trans-3-Aminocyclopentanol hydrochloride | 124555-33-5 | 2A-9051629 |
| Tetrahydro-1H-pyrrolizine-7a(5H)-acetic acid hydrochloride | 124655-63-6 | 2A-9051632 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA