CAS Number121250-47-3
SynonymsConjugated Linolenic Acid,CLA; CIS-10-CIS-12-CONJUGATEDLINOLEICACID; TRANS-10,TRANS-12-OCTADECADIENOICACID; 9,11-Linoleic acid; (9E,11E)-octadeca-9,11-dienoic acid; (9E,11E)-9,11-Octadecadienoic acid; CIS-10,CIS-12-OCTADECADIENOICACID; 9-cis,12-cis-Octadecadienoic acid; (9Z,12Z)-9,12-Octadecadienoic acid; cis-Linoleic acid; 9,11-Octadecadienoic acid; (9Z,12Z)-octadeca-9,12-dienoic acid
Molecular FormulaC18H32O2
Molecular Weight280.45
Purity≥98.0 (HPLC)%
Density0.9±0.1 g/cm3
Boiling Point381.6±11.0 °C at 760 mmHg
AppearanceColorless to light yellow liquid
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 121250-47-3 |
| Catalog No. | 2A-9051414 |
| Chinese Name | 共轭亚麻油酸 |
| Synonyms | Conjugated Linolenic Acid,CLA; CIS-10-CIS-12-CONJUGATEDLINOLEICACID; TRANS-10,TRANS-12-OCTADECADIENOICACID; 9,11-Linoleic acid; (9E,11E)-octadeca-9,11-dienoic acid; (9E,11E)-9,11-Octadecadienoic acid; CIS-10,CIS-12-OCTADECADIENOICACID; 9-cis,12-cis-Octadecadienoic acid; (9Z,12Z)-9,12-Octadecadienoic acid; cis-Linoleic acid; 9,11-Octadecadienoic acid; (9Z,12Z)-octadeca-9,12-dienoic acid |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 |
| Purity | ≥98.0 (HPLC) |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 381.6±11.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | 2-8°C, dry |
| HTC | 2916150000 |
| PubChem ID | 329769982 |
| MDL Number | MFCD00133681 |
| SMILES | CCCCCC\C=C\C=C\CCCCCCCC(O)=O |
| InChI | 1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9+ |
| InChI Key | JBYXPOFIGCOSSB-XBLVEGMJSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 85151701 |
| MSDS | msds/51414_1_121250_47_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2916150000 oleic, linoleic or linolenic acids, their salts and esters. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3-Difluoro-4'-pentylbiphenyl | 121219-17-8 | 2A-9051407 |
| 1,3-Difluoro-5-pentylbenzene | 121219-25-8 | 2A-9051408 |
| 4-Octyloxydiphenyliodonium hexafluoroantimonate | 121239-75-6 | 2A-9051409 |
| Tetrabutylphosphonium fluoride | 121240-56-0 | 2A-9051410 |
| 1-(2,3-Difluoro-6-nitrophenyl)propan-2-one | 121247-16-3 | 2A-9051413 |
| 2-[2-[(3-Aminobenzoyl)amino]ethylsulfonyl]ethyl hydrogen sulfate | 121315-20-6 | 2A-9051417 |
| 2-Imidazolidone hemihydrate | 121325-67-5 | 2A-9051418 |
| N-Isopropyl-3-fluoroaniline | 121431-27-4 | 2A-9051422 |
| 4,5:4',5'-Dibenzo-1,1'-dibutyl-3,3,3',3'-tetramethylindadicarbocyanine perchlorate | 121482-73-3 | 2A-9051425 |
| 4,4'-[(Phenylphosphinylidene)bis(4,1-phenyleneoxy)]bisbenzenamine | 121566-10-7 | 2A-9051429 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS