
CAS Number121219-12-3
Synonyms4-Amylbenzeneboronic Acid; 4-n-Pentylbenzeneboronic acid; 4-n-Pentylphenylboronicacid; MFCD00995151; 4-Amylphenylboronic Acid; (4-Pentylphenyl)boronic acid; 4-Pentylphenylboronic Acid; 4-pentylbenzeneboronic acid
Molecular FormulaC11H17O2B1
Molecular Weight192.07
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point328.0±35.0 °C at 760 mmHg
Melting Point82-84°C
AppearanceYellow brown powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 121219-12-3 |
| Catalog No. | 2A-9051405 |
| Chinese Name | 4-正戊基苯硼酸 |
| Synonyms | 4-Amylbenzeneboronic Acid; 4-n-Pentylbenzeneboronic acid; 4-n-Pentylphenylboronicacid; MFCD00995151; 4-Amylphenylboronic Acid; (4-Pentylphenyl)boronic acid; 4-Pentylphenylboronic Acid; 4-pentylbenzeneboronic acid |
| Molecular Formula | C11H17O2B1 |
| Molecular Weight | 192.07 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 328.0±35.0 °C at 760 mmHg |
| Melting Point | 82-84°C |
| Appearance | Yellow brown powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2931900090 |
| MDL Number | MFCD00995151 |
| SMILES | CCCCCc1ccc(cc1)B(O)O |
| InChI | InChI=1S/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
| InChI Key | InChIKey=UZRMPSOGFATLJE-UHFFFAOYSA-N |
| MSDS | msds/51405_1_121219_12_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: 4-n-pentylphenylboronic acid (containing varying amounts of anhydride) |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-(Bromomethyl)-1,2,3,4-tetrahydro-1,1,4,4-tetramethylnaphthalene | 119435-90-4 | 2A-9051270 |
| Triethyl(trifluoromethyl)silane | 120120-26-5 | 2A-9051321 |
| 3-Carboxy-4-fluorophenylboronic acid | 120153-08-4 | 2A-9051324 |
| (E)-3-[2-(7-Chloro-2-quinolinyl)ethenyl]benzaldehyde | 120578-03-2 | 2A-9051357 |
| 3-Formyl-4-methoxyphenylboronic acid | 121124-97-8 | 2A-9051395 |
| 4-[2-(Methyl-2-pyridinylamino)ethoxy]benzaldehyde | 122321-03-3 | 2A-9051469 |
| 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-ol | 122431-37-2 | 2A-9051480 |
| Ethyl 2-(trifluoromethylsulfonyloxy)-1-cyclopentene-1-carboxylate | 122539-74-6 | 2A-9051494 |
| 3-Fluorocyclobutanecarboxylic acid | 122665-96-7 | 2A-9051501 |
| 4,4-Difluorocyclohexanecarboxylic acid | 122665-97-8 | 2A-9051502 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA