
CAS Number119389-05-8
Synonyms5-(Phenylethynyl)isobenzofuran-1,3-dione; 4-Phenylethynylphthalic Anhydride; 5-(2-phenylethynyl)-2-benzofuran-1,3-dione; 5-(Phenylethynyl)-2-benzofuran-1,3-dione
Molecular FormulaC16H8O3
Molecular Weight248.233
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point466.9±28.0 °C at 760 mmHg
Melting Point152ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 119389-05-8 |
| Catalog No. | 2A-9051265 |
| Chinese Name | 4-苯乙炔基苯酐(4-PEPA) |
| Synonyms | 5-(Phenylethynyl)isobenzofuran-1,3-dione; 4-Phenylethynylphthalic Anhydride; 5-(2-phenylethynyl)-2-benzofuran-1,3-dione; 5-(Phenylethynyl)-2-benzofuran-1,3-dione |
| Molecular Formula | C16H8O3 |
| Molecular Weight | 248.233 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 466.9±28.0 °C at 760 mmHg |
| Melting Point | 152ºC |
| Storage Condition | room temperature, dry |
| HTC | 2932999099 |
| SMILES | O=C1OC(=O)c2cc(C#Cc3ccccc3)ccc21 |
| InChI Key | UPGRRPUXXWPEMV-UHFFFAOYSA-N |
| MSDS | msds/51265_1_119389_05_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| 2-Deoxy-L-threo-pentonic acid gamma-lactone | 78185-09-8 | 2A-9048186 |
| Bis(2,6-di-ter-butyl-4-methylphenyl)pentaerythritol-diphosphite | 80693-00-1 | 2A-9048518 |
| N-Methyl-gamma-(2-methylphenoxy)phenylpropylamine hydrochloride | 107674-15-7 | 2A-9050362 |
| 5-(p-Toluenesulfonate)-2,3-O-isopropylidene-2-C-methyl-D-ribonic-gamma-lactone | 109715-12-0 | 2A-9050466 |
| 2-(Nonafluorobutyl)ethyl acrylate | 117374-41-1 | 2A-9051098 |
| Bis(2,4,6-tri-ter-butyllphenyl)pentaerythritol-di-phosphite | 126505-35-9 | 2A-9051744 |
| C18-fatty acids dimers polymers with adipic acid and neopentyl glycol | 276869-34-2 | 2A-9056258 |
| Odanacatib | 603139-19-1 | 2A-9057678 |
| 2-Naphthalenylthioethyl acrylate | 897049-32-0 | 2A-9058976 |
| 5-O-Methanesulfonate-2,3-O-isopropylidene-2-C-methyl-D-ribonic-gamma-lactone | 908128-94-9 | 2A-9059029 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA