
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 119344-67-1 |
| Catalog No. | 2A-9051261 |
| Chinese Name | alpha-溴代对氟苯丁酮 |
| Synonyms | 2-bromo-1-(4-fluorophenyl)-1-butanone |
| Molecular Formula | C10H10BrFO |
| Molecular Weight | 296.12 |
| Purity | 98.00 |
| Density | 1.427 |
| Boiling Point | 278ºC |
| Appearance | solid |
| HTC | 2914700090 |
| PubChem ID | 329826312 |
| MDL Number | MFCD04124730 |
| SMILES | BrCC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | 1S/C12H10BrNO3/c13-7-8(15)5-6-14-11(16)9-3-1-2-4-10(9)12(14)17/h1-4H,5-7H2 |
| InChI Key | PTPZBCHKQSHXQZ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/51261_1_119344_67_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tris(4-formylphenyl)amine | 119001-43-3 | 2A-9051234 |
| 4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesulfonamide | 119018-29-0 | 2A-9051237 |
| Epristeride | 119169-78-7 | 2A-9051244 |
| 1-Methyl-3-propylimidazolium iodide | 119171-18-5 | 2A-9051245 |
| 2-Benzyl-2-(dimethylamino)-4'-morpholinobutyrophenone | 119313-12-1 | 2A-9051260 |
| Keycure 8179 | 119344-86-4 | 2A-9051262 |
| R-(+)-Dihydrolipoic acid | 119365-69-4 | 2A-9051264 |
| Difenoconazole | 119446-68-3 | 2A-9051271 |
| 1,3-Bis(citraconimidomethyl)benzene | 119462-56-5 | 2A-9051272 |
| L-Norvaline tert-butyl ester hydrochloride | 119483-47-5 | 2A-9051275 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA