
CAS Number115256-13-8
SynonymsN-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ehtanamine; N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ethanamine; FC1322; 1-(4-aminophenoxy)-2-[N-(4-aminophenethyl)-N-mathylamino]ethane; 4-(2-{[2-(4-Aminophenoxy)ethyl](methyl)amino}ethyl)aniline; N-Methyl-N-[2-(4-aminophenoxy)ethyl]-4-aminophenethylamine; 1-(4-aminophenoxy)-2-[N-(4-aminophenethyl)-N-methylamino]ethane
Molecular FormulaC17H23N3O
Molecular Weight285.384
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point488.3±40.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 115256-13-8 |
| Catalog No. | 2A-9050914 |
| Chinese Name | N-甲基-N-4-氨基苯氧乙基--4-氨基苯乙胺 |
| Synonyms | N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ehtanamine; N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ethanamine; FC1322; 1-(4-aminophenoxy)-2-[N-(4-aminophenethyl)-N-mathylamino]ethane; 4-(2-{[2-(4-Aminophenoxy)ethyl](methyl)amino}ethyl)aniline; N-Methyl-N-[2-(4-aminophenoxy)ethyl]-4-aminophenethylamine; 1-(4-aminophenoxy)-2-[N-(4-aminophenethyl)-N-methylamino]ethane |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.384 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 488.3±40.0 °C at 760 mmHg |
| HTC | 2922299090 |
| SMILES | CN(CCOc1ccc(N)cc1)CCc1ccc(N)cc1 |
| InChI Key | QZYRUZJJDBUKII-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/50914_1_115256_13_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methylphenyl-D-alanine | 114926-39-5 | 2A-9050889 |
| 1-Benzylimidazolidin-4-one | 114981-11-2 | 2A-9050892 |
| Tris(2,5-dimethylphenyl)phosphine | 115034-38-3 | 2A-9050898 |
| Mupirocin calcium dihydrate | 115074-43-6 | 2A-9050901 |
| Tetrabenzyl-voglibose | 115250-39-0 | 2A-9050912 |
| 2-(4-Aminophenyl)-2-methylpropanenitrile | 115279-57-7 | 2A-9050916 |
| N-Methyl-N-(2-(4-nitrophenoxy)ethyl)-2-(4-nitrophenyl)ethanamine | 115287-37-1 | 2A-9050917 |
| 6-Chloronicotinic acid tert-butyl ester | 115309-57-4 | 2A-9050918 |
| 6-Chloro-N-tert-butylnicotinamide | 115309-58-5 | 2A-9050919 |
| 3-Hydroxy-1-adamantyl methacrylate | 115372-36-6 | 2A-9050924 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA