![2-[2-[[(Phenylmethoxy)carbonyl]amino]-4-thiazolyl]-2-pentenedioic acid 5-(3-methyl-2-butenyl) ester structure, CAS 115065-79-7](/structures/60000/50900_1_115065_79_7.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 115065-79-7 |
| Catalog No. | 2A-9050900 |
| Chinese Name | 头孢布烯侧链 |
| Synonyms | Exact Mass 430.119843; PSA 143.06000; LogP 4.73; Index of Refraction 1.618; InChIKey QSJNRPJXKFDFPH-PXNMLYILSA-N |
| Molecular Formula | C21H22O6N2S1 |
| Molecular Weight | 430.48 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2934100090 |
| MDL Number | MFCD09750993 |
| SMILES | CC(C)=CCOC(=O)CC=C(C(=O)O)c1csc(NC(=O)OCc2ccccc2)n1 |
| InChI Key | QSJNRPJXKFDFPH-PXNMLYILSA-N |
| MSDS | msds/50900_1_115065_79_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Imidazolyl-L-alanine | 114717-14-5 | 2A-9050847 |
| 7-Bromo-1,2,3,4-tetrahydroquinoline hydrochloride | 114744-51-3 | 2A-9050851 |
| 3-(Piperazin-1-ylmethyl)-1H-indole | 114746-66-6 | 2A-9050853 |
| 4-Chloro-6-(1H-imidazol-1-yl)pyrimidine | 114834-02-5 | 2A-9050865 |
| 2,3-Dihydro-1-benzofuran-5-sulfonyl chloride | 115010-11-2 | 2A-9050894 |
| 6-Hydroxy-3-methylpyridine-2-carboxylic acid | 115185-81-4 | 2A-9050908 |
| alpha-(4-Hydroxyphenyl)-3-pyridineethanol | 115382-40-6 | 2A-9050925 |
| 3-(N-Acetyl-N-ethylamino)pyrrolidine | 115445-29-9 | 2A-9050928 |
| 5,6,7,7a-Tetrahydrothieno[3,2-c]pyridine-2(4H)-one hydrochloride | 115473-15-9 | 2A-9050930 |
| 4-Bromopyridazine | 115514-66-4 | 2A-9050931 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA