![4-[N-Methyl-N-(2-chloroethyl)]aminobenzaldehyde structure, CAS 94-31-5](/structures/20000/5066_1_94_31_5.png)
CAS Number94-31-5
Synonymsp-((2-Chloroethyl)methylamino)benzaldehyde; 4-((2-chloroethyl)methylamino)benzaldehyde; 4-[(2-Chloroethyl)(methyl)amino]benzaldehyde; 4-[N-Methyl-N-(2-chloroethyl)] amino benzaldehyde; einecs 202-321-3; MFCD00071777
Molecular FormulaC10H12ClNO
Molecular Weight197.661
Purity98%
Density1.2±0.1 g/cm3
Boiling Point328.7±27.0 °C at 760 mmHg
Melting Point72-94°C
AppearanceSlightly yellow solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 94-31-5 |
| Catalog No. | 2A-9005066 |
| Chinese Name | N-甲基-N-氯乙基-4-氨基苯甲醛 |
| Synonyms | p-((2-Chloroethyl)methylamino)benzaldehyde; 4-((2-chloroethyl)methylamino)benzaldehyde; 4-[(2-Chloroethyl)(methyl)amino]benzaldehyde; 4-[N-Methyl-N-(2-chloroethyl)] amino benzaldehyde; einecs 202-321-3; MFCD00071777 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.661 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 328.7±27.0 °C at 760 mmHg |
| Melting Point | 72-94°C |
| Appearance | Slightly yellow solid |
| Storage Condition | Room temperature, store in inert gas |
| Packaging | I; II; III |
| HTC | 2922399090 |
| SMILES | CN(CCCl)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C10H12ClNO/c1-12(7-6-11)10-4-2-9(8-13)3-5-10/h2-5,8H,6-7H2,1H3 |
| InChI Key | IYFULQJDHJGQKQ-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/5066_1_94_31_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-[1-(2,5-Dimethylpyrrolo)]benzohydrazide | 26165-67-3 | 2A-9005050 |
| 4-[3-(Trifluoromethyl)phenyl]-4-piperidinol | 2249-28-7 | 2A-9005058 |
| 4-[3,5-Bis(trifluoromethyl)phenyl]-3-thiosemicarbazide | 38901-31-4 | 2A-9005059 |
| 4-[4-(tert-Butyl)-1,3-thiazol-2-yl]benzaldehyde | 175202-78-5 | 2A-9005064 |
| 4-[4-Chloro-3-(trifluoromethyl)phenyl]-4-piperidinol | 21928-50-7 | 2A-9005065 |
| 4-[N-Methyl-N-(cyanoethyl)]aminobenzaldehyde | 94-21-3 | 2A-9005067 |
| 4-Acetylaminobenzaldehyde | 122-85-0 | 2A-9005080 |
| 4-Acetylphenylboronic acid | 149104-90-5 | 2A-9005082 |
| 4-Amino-2-trifluoromethylbenzonitrile | 654-70-6 | 2A-9005117 |
| 4-Amino-3-trifluoromethylbenzoic acid | 400-70-6 | 2A-9005145 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA