
CAS Number111358-88-4
SynonymsSP 924; Lestaurtinib; KT 5555; CEP-701 hydrate; CEP-701; UNII-DO989GC5D1
Molecular FormulaC26H21N3O4
Molecular Weight439.46 (anhydrous basis)
Purity≥98 (HPLC)%
Density1.7±0.1 g/cm3
Boiling Point723.0±60.0 °C at 760 mmHg
Melting Point215-220ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 111358-88-4 |
| Catalog No. | 2A-9050582 |
| Chinese Name | 来他替尼 |
| Synonyms | SP 924; Lestaurtinib; KT 5555; CEP-701 hydrate; CEP-701; UNII-DO989GC5D1 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.46 (anhydrous basis) |
| Purity | ≥98 (HPLC) |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 723.0±60.0 °C at 760 mmHg |
| Melting Point | 215-220ºC |
| Appearance | powder |
| Water Solubility | DMSO: >10mg/mL |
| Storage Condition | Desiccate at -20°C |
| Application | Lestaurtinib (CEP-701; KT-5555) is a multikinase inhibitor with potent activity against the Trk receptor tyrosine kinase family. Lestaurtinib inhibits JAK2, FLT3 and TrkA with IC50s of 0.9, 3 and less |
| PubChem ID | 329775153 |
| MDL Number | MFCD12828858 |
| SMILES | O.C[C@]12O[C@H](C[C@]1(O)CO)n3c4ccccc4c5c6C(=O)NCc6c7c8ccccc8n2c7c35 |
| InChI | 1S/C26H21N3O4.H2O/c1-25-26(32,12-30)10-18(33-25)28-16-8-4-2-6-13(16)20-21-15(11-27-24(21)31)19-14-7-3-5-9-17(14)29(25)23(19)22(20)28;/h2-9,18,30,32H,10-12H2,1H3,(H,27,31);1H2/t18-,25+,26+;/m1./s1 |
| InChI Key | LPOQWFBZBJTLEO-GMEYHWBASA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/50582_1_111358_88_4.pdf |
| Transport Info | Product name: Lestaurtinib |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(1,2-Dimethylpropyl)-2-pyridinamine | 111098-37-4 | 2A-9050569 |
| Benzyl N,N-dibenzyl-L-phenylalaninate | 111138-83-1 | 2A-9050573 |
| D-3-(3-Benzothienyl)alanine | 111139-55-0 | 2A-9050574 |
| Tetramethylammonium fluoride trihydrate | 111203-44-2 | 2A-9050577 |
| Ono-4007 (free acid) | 111250-67-0 | 2A-9050578 |
| Isobutylisopropyldimethoxysilane | 111439-76-0 | 2A-9050585 |
| 5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol | 111549-97-4 | 2A-9050591 |
| 2-(1H-Pyrazol-3-yl)aniline | 111562-32-4 | 2A-9050592 |
| Metobenzuron | 111578-32-6 | 2A-9050593 |
| Ethyl 2-(2-mercapto-4-methyl-1,3-thiazol-5-yl)acetate | 111874-19-2 | 2A-9050605 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA