
CAS Number108468-00-4
SynonymsCarbamic acid, N-[[4-(aminomethyl)phenyl]methyl]-, 1,1-dimethylethyl ester; tert-butyl N-[[4-(aminomethyl)phenyl]methyl]carbamate; 1-(N-BOC-aminomethyl)-4-(aminomethyl)benzene; tert-Butyl [4-(aminomethyl)benzyl]carbamate; 2-Methyl-2-propanyl [4-(aminomethyl)benzyl]carbamate; MFCD02683058
Molecular FormulaH2NCH2C6H4CH2NHCO2C(CH3)3
Molecular Weight236.31
Purity95%
Density1.1±0.1 g/cm3
Boiling Point384.7±30.0 °C at 760 mmHg
Melting Point64-68 °C (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 108468-00-4 |
| Catalog No. | 2A-9050406 |
| Chinese Name | 1-(N-Boc-氨基甲基)-4-(氨基甲基)苯 |
| Synonyms | Carbamic acid, N-[[4-(aminomethyl)phenyl]methyl]-, 1,1-dimethylethyl ester; tert-butyl N-[[4-(aminomethyl)phenyl]methyl]carbamate; 1-(N-BOC-aminomethyl)-4-(aminomethyl)benzene; tert-Butyl [4-(aminomethyl)benzyl]carbamate; 2-Methyl-2-propanyl [4-(aminomethyl)benzyl]carbamate; MFCD02683058 |
| Molecular Formula | H2NCH2C6H4CH2NHCO2C(CH3)3 |
| Molecular Weight | 236.31 |
| Purity | 95 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 384.7±30.0 °C at 760 mmHg |
| Melting Point | 64-68 °C (lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2924299090 |
| PubChem ID | 24878400 |
| MDL Number | MFCD02683058 |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CN)cc1 |
| InChI | 1S/C13H20N2O2/c1-13(2,3)17-12(16)15-9-11-6-4-10(8-14)5-7-11/h4-7H,8-9,14H2,1-3H3,(H,15,16) |
| InChI Key | NUANLVJLUYWSER-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/50406_1_108468_00_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| N-Boc-(2S,3S)-(-)-2-Amino-3-methyl-1-pentanol | 106946-74-1 | 2A-9050315 |
| 5-Bromo-4-chloro-3-indolyl-alpha-D-galactopyranoside | 107021-38-5 | 2A-9050323 |
| (R)-(-)-2-Benzylamino-1-phenylethanol | 107171-75-5 | 2A-9050332 |
| 6-(1-Piperazinyl)-2(1H)-pyridinone | 108122-24-3 | 2A-9050377 |
| Thiazolo[5,4-c]pyridin-2-amine | 108310-79-8 | 2A-9050387 |
| (R)-Octahydro-1H-indole-2-carboxylic acid | 108507-42-2 | 2A-9050409 |
| 1,2,3,4-Tetrahydro-2,7-naphthyridine | 108749-08-2 | 2A-9050420 |
| (R)-4-Amino-3-(naphthalen-1-yl)butanoic acid | 108827-19-6 | 2A-9050422 |
| (S)-(-)-1,1,2-Triphenylethane-1,2-diol | 108998-83-0 | 2A-9050432 |
| (1R,4S)-N-Boc-1-aminocyclopent-2-ene-4-carboxylic acid | 108999-93-5 | 2A-9050433 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA