
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104472-68-6 |
| Catalog No. | 2A-9050114 |
| Chinese Name | 香蒲新苷 |
| Synonyms | I07-0144; Typhaneoside; N1474; isorhamnetin 3-O-2G-rhamnosylrutinoside |
| Molecular Formula | C34H42O20 |
| Molecular Weight | 770.69 |
| Purity | 98.00 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1065.0±65.0 °C at 760 mmHg |
| Storage Condition | 2~8°C |
| Application | Typhaneoside, extracted from Typha angustifolia L., inhibits excessive autophagy in hypoxic/reoxygenated cells and increases the phosphorylation of Akt and mTOR. Typhaneoside has certain effects on th |
| SMILES | OC1=CC(O)=C(C(C(O[C@H]2[C@H](O[C@]3([H])O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@@H](CO[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4)O2)=C(C5=CC(OC)=C(O)C=C5)O6)=O)C6=C1 |
| InChI | 1S/C34H42O20/c1-10-20(38)24(42)27(45)32(49-10)48-9-18-22(40)26(44)31(54-33-28(46)25(43)21(39)11(2)50-33)34(52-18)53-30-23(41)19-15(37)7-13(35)8-17(19)51-29(30)12-4-5-14(36)16(6-12)47-3/h4-8,10-11,18,20-22,24-28,31-40,42-46H,9H2,1-3H3/t10-,11-,18+,20-,21-,22+,24+,25+,26-,27+,28+,31+,32+,33-,34?/m0/s1 |
| InChI Key | POMAQDQEVHXLGT-QQVXUORWSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/50114_1_104472_68_6.pdf |
| Transport Info | Product name: Typha neoglucoside |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline | 104147-32-2 | 2A-9050084 |
| HC Yellow 7 | 104226-21-3 | 2A-9050096 |
| Ethyl 4-hydroxy-2-nitrobenzoate | 104356-27-6 | 2A-9050106 |
| Distyrylphenol ethoxylates | 104376-75-2 | 2A-9050109 |
| 2-Aminoethylmethylsulfone hydrochloride | 104458-24-4 | 2A-9050112 |
| Sodium 3-(1-naphthylamino)propanesulfonate | 104484-71-1 | 2A-9050115 |
| Phenethyl caffeate | 104594-70-9 | 2A-9050121 |
| 4-(Phthalimide)cyclohexanol | 104618-31-7 | 2A-9050125 |
| 4-Phthalimidocyclohexanone | 104618-32-8 | 2A-9050126 |
| 4-Propylphenyl 4-(trans-4-ethylcyclohexyl)benzoate | 104633-43-4 | 2A-9050130 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA