
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 103015-84-5 |
| Catalog No. | 2A-9049953 |
| Chinese Name | 2,5-二氯-4-(1,1,2,3,3,3-六氟丙氧基)苯胺 |
| Synonyms | 2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)BENZENAMINE; Benzenamine,2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy) |
| Molecular Formula | C9H5Cl2F6NO |
| Molecular Weight | 328.04 |
| Purity | 98.00 |
| Density | 1.594 |
| Boiling Point | 280ºC |
| Storage Condition | 2-8°C, protected from light, stored under inert ga |
| HTC | 2922299090 |
| PubChem ID | 14826525 |
| SMILES | Nc1cc(Cl)c(OC(F)(F)C(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H5Cl2F6NO/c10-3-2-6(4(11)1-5(3)18)19-9(16,17)7(12)8(13,14)15/h1-2,7H,18H2 |
| InChI Key | PIANCHDAVNRLDV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tau-fluvalinate | 102851-06-9 | 2A-9049942 |
| 4-(2-Pyridinyl)butanoic acid | 102879-51-6 | 2A-9049946 |
| 2-Chloro-3-fluorobenzoic acid | 102940-86-3 | 2A-9049948 |
| 2,6-Decahydronaphthalenediol | 102942-69-8 | 2A-9049949 |
| N,N'-Bis[[4-(2-propen-1-yloxy)phenyl]methylene]-1,4-benzenediamine | 102947-88-6 | 2A-9049950 |
| 6-Methoxy-1-aminoindan hydrochloride | 103028-80-4 | 2A-9049955 |
| 6-Bromo-2-methyl-4-quinolinol | 103030-28-0 | 2A-9049956 |
| Ethyl 3-(pyridin-2-ylamino)propanoate | 103041-38-9 | 2A-9049959 |
| Daptomycin | 103060-53-3 | 2A-9049964 |
| D-Prallethrin | 103065-19-6 | 2A-9049965 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA