CAS Number101420-81-9
SynonymsBenzoic acid,3-bromo-4-nitro; MFCD04117949; 4-Nitro-3-bromobenzoic acid; 3-Bromo-4-nitrobenzoicacid; 3-Bromo-4-nitrobenzoic acid; 3-Brom-4-nitro-benzoesaeure
Molecular FormulaHOC6H3(NO2)CO2H
Molecular Weight183.12
Purity95%
Density1.9±0.1 g/cm3
Boiling Point364.4±32.0 °C at 760 mmHg
Melting Point229-231 °C (lit.)
AppearanceWhite to brown crystal or powder
EINECS210-580-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 101420-81-9 |
| Catalog No. | 2A-9049825 |
| Chinese Name | 3-溴-4-硝基苯甲酸 |
| Synonyms | Benzoic acid,3-bromo-4-nitro; MFCD04117949; 4-Nitro-3-bromobenzoic acid; 3-Bromo-4-nitrobenzoicacid; 3-Bromo-4-nitrobenzoic acid; 3-Brom-4-nitro-benzoesaeure |
| Molecular Formula | HOC6H3(NO2)CO2H |
| Molecular Weight | 183.12 |
| Purity | 95 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 364.4±32.0 °C at 760 mmHg |
| Melting Point | 229-231 °C (lit.) |
| Appearance | White to brown crystal or powder |
| Storage Condition | Store airtight in a cool, dry warehouse. Keep away |
| EINECS | 210-580-9 |
| HTC | 2916399090 |
| PubChem ID | 24895657 |
| MDL Number | MFCD00007110 |
| SMILES | OC(=O)c1ccc(c(O)c1)[N+]([O-])=O |
| InChI | 1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChI Key | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2107564 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/49825_1_101420_81_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-4-fluoroiodobenzene | 101335-11-9 | 2A-9049811 |
| endo-N-Benzyl-endo-3-aminotropane | 101353-61-1 | 2A-9049814 |
| Silicic acid aluminum sodium salt sulfurized | 101357-30-6 | 2A-9049815 |
| 2-Chloro-1,3-dimethylimidazolidinium hexafluorophosphate | 101385-69-7 | 2A-9049818 |
| Palm kernel-oil fatty acids | 101403-98-9 | 2A-9049822 |
| 2-Isobutyl-4,6-dimethyldihydro-4H-1,3,5-dithiazine | 101517-87-7 | 2A-9049835 |
| 4,4'-Methylenebis(2,6-dimethylphenylcyanate) | 101657-77-6 | 2A-9049841 |
| 2-Isopropyl-1(2H)-isoquinolinone | 101712-97-4 | 2A-9049848 |
| 6-Isopropylpyridin-3-ol | 101870-78-4 | 2A-9049859 |
| 4-Fluorogramine | 101909-46-0 | 2A-9049860 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS