
CAS Number100442-33-9
Synonyms1-[(3,3-Diphenylpropyl)(methyl)amino]-2-methyl-2-propanol; QX1&1&1N1&2YR&R; 1-[(3,3-Diphenylpropyl)methylamino]-2-methyl-2-propanol; 1-(3,3-Diphenyl-N-methylpropylamino)-2-methyl-2-propanol; MFCD07782118
Molecular FormulaC20H27O1N1
Molecular Weight297.44
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point428.9±40.0 °C at 760 mmHg
AppearanceLight yellow oily liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100442-33-9 |
| Catalog No. | 2A-9049723 |
| Chinese Name | 2,N-二甲基-N-(3,3-二苯基丙基)-1-氨基-2-丙醇 |
| Synonyms | 1-[(3,3-Diphenylpropyl)(methyl)amino]-2-methyl-2-propanol; QX1&1&1N1&2YR&R; 1-[(3,3-Diphenylpropyl)methylamino]-2-methyl-2-propanol; 1-(3,3-Diphenyl-N-methylpropylamino)-2-methyl-2-propanol; MFCD07782118 |
| Molecular Formula | C20H27O1N1 |
| Molecular Weight | 297.44 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 428.9±40.0 °C at 760 mmHg |
| Appearance | Light yellow oily liquid |
| Storage Condition | 2-8°C |
| HTC | 2922199090 |
| PubChem ID | 15893892 |
| MDL Number | MFCD07782118 |
| SMILES | CN(CCC(c1ccccc1)c1ccccc1)CC(C)(C)O |
| InChI | InChI=1S/C20H27NO/c1-20(2,22)16-21(3)15-14-19(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19,22H,14-16H2,1-3H3 |
| InChI Key | MQWDISMNBYOLAB-UHFFFAOYSA-N |
| MSDS | msds/49723_1_100442_33_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 2-(5-methyl-4H-1,2,4-triazol-3-yl)acetate | 100187-10-8 | 2A-9049693 |
| N-Phenyl-3-piperidinamine | 100240-05-9 | 2A-9049698 |
| Milrinone lactate | 100286-97-3 | 2A-9049701 |
| 3-Amino-4-bromophenol | 100367-37-1 | 2A-9049710 |
| N-(2-Cyano-1-cyclopenten-1-yl)-acetamide | 100377-16-0 | 2A-9049718 |
| Ethyl 1-methylbutyl cyanoacetate | 100453-11-0 | 2A-9049724 |
| Methyl 3-[4-(aminomethyl)phenyl]propionate | 100511-78-2 | 2A-9049732 |
| Dimethylsilylbis(tetramethylcyclopentadienyl)zirconium dichloride | 100516-64-1 | 2A-9049734 |
| 4-Ethyl-3-hydroxybenzoic acid | 100523-85-1 | 2A-9049736 |
| 1-(4-Fluorophenyl)-3-methyl-2-pyrazolin-5-one | 100553-83-1 | 2A-9049739 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA