
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100125-12-0 |
| Catalog No. | 2A-9049689 |
| Chinese Name | 3,8-二溴-1,10-菲咯啉 |
| Synonyms | 3,8-Dibromo-1,10-phenanthroline |
| Molecular Formula | C12H6Br2N2 |
| Molecular Weight | 338 |
| Purity | 98.00 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 428.9±40.0 °C at 760 mmHg |
| Melting Point | 282 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | room temperature |
| HTC | 2933990090 |
| PubChem ID | 16050215 |
| SMILES | Brc1cnc2c(ccc3cc(Br)cnc32)c1 |
| InChI | InChI=1S/C12H6Br2N2/c13-9-3-7-1-2-8-4-10(14)6-16-12(8)11(7)15-5-9/h1-6H |
| InChI Key | IDWJREBUVYSPKS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| S-Alpine-Hydride | 100013-07-8 | 2A-9049678 |
| PIPES sesquisodium salt | 100037-69-2 | 2A-9049679 |
| rac-Ethylenebis(1-indenyl)zirconium dichloride | 100080-82-8 | 2A-9049683 |
| Aloe vera oil | 100084-89-7 | 2A-9049684 |
| Commiphora extract | 100084-96-6 | 2A-9049685 |
| Benzyl (1-cyano-1-methylethyl)carbamate | 100134-82-5 | 2A-9049690 |
| rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium dichloride | 100163-29-9 | 2A-9049692 |
| Ethyl 2-(5-methyl-4H-1,2,4-triazol-3-yl)acetate | 100187-10-8 | 2A-9049693 |
| N-Phenyl-3-piperidinamine | 100240-05-9 | 2A-9049698 |
| Milrinone lactate | 100286-97-3 | 2A-9049701 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA