
CAS Number100124-07-0
Synonyms4-PHENOXATHIINYLBORONIC ACID; phenoxathiin-4-yl-boronic acid; phenoxanthiin-4-boronic acid; Dihydroxy-phenoxathiin-4-yl-boran; 4-phenoxathiineboronic acid; dihydroxy-phenoxathiin-4-yl-borane; Boronic acid,B-4-phenoxathiinyl; Phenoxathiin-4-boronic acid; Phenoxathiin-4-ylboronic acid; MFCD01605731
Molecular FormulaC12H9BO3S
Molecular Weight244.079
Purity98.00%
Density1.45 g/cm3
Boiling Point457.5ºC at 760 mmHg
Melting Point162-167 °C
AppearanceWhite to beige crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100124-07-0 |
| Catalog No. | 2A-9049688 |
| Chinese Name | 吩恶噻-4-硼酸 |
| Synonyms | 4-PHENOXATHIINYLBORONIC ACID; phenoxathiin-4-yl-boronic acid; phenoxanthiin-4-boronic acid; Dihydroxy-phenoxathiin-4-yl-boran; 4-phenoxathiineboronic acid; dihydroxy-phenoxathiin-4-yl-borane; Boronic acid,B-4-phenoxathiinyl; Phenoxathiin-4-boronic acid; Phenoxathiin-4-ylboronic acid; MFCD01605731 |
| Molecular Formula | C12H9BO3S |
| Molecular Weight | 244.079 |
| Purity | 98.00 |
| Density | 1.45 g/cm3 |
| Boiling Point | 457.5ºC at 760 mmHg |
| Melting Point | 162-167 °C |
| Appearance | White to beige crystalline powder |
| Storage Condition | 0-6°C |
| HTC | 2934999090 |
| PubChem ID | 3155184 |
| MDL Number | MFCD01605731 |
| SMILES | OB(O)c1cccc2Sc3ccccc3Oc12 |
| InChI | InChI=1S/C12H9BO3S/c14-13(15)8-4-3-7-11-12(8)16-9-5-1-2-6-10(9)17-11/h1-7,14-15H |
| InChI Key | InChIKey=IIENVBUXFRSCLM-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Methoxycarbonylphenylboronic acid | 99769-19-4 | 2A-9049666 |
| Methyl 2-amino-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate | 99907-80-9 | 2A-9049673 |
| 2-Amino-1,2,3,4-tetrahydro-5,8-dimethoxy-2-naphthalenecarboxylic acid | 99907-84-3 | 2A-9049674 |
| 2-Phenyl-2H-1-benzopyran-3-carboxylic acid | 99943-60-9 | 2A-9049676 |
| 4-Dibenzofuranboronic acid | 100124-06-9 | 2A-9049687 |
| 2,6-Dimethylphenylboronic acid | 100379-00-8 | 2A-9049719 |
| Diethanolamine-(3R)-(+)-tetrahydrofuranylboronate | 100858-40-0 | 2A-9049768 |
| 4'-Hydroxy(1,1'-biphenyl)-4-carboxaldehyde | 100980-82-3 | 2A-9049783 |
| 2-Chloroisonicotinaldehyde | 101066-61-9 | 2A-9049788 |
| 4-Iodo-2-(trifluoromethyl)benzonitrile | 101066-87-9 | 2A-9049789 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA