
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 99665-00-6 |
| Catalog No. | 2A-9049651 |
| Chinese Name | 氟氧头孢 |
| Synonyms | FMOX; Flomoxefum; MFCD00865115; Flomoxefo; Flomoxef |
| Molecular Formula | C15H18F2N6O7S2 |
| Molecular Weight | 518.45 |
| Purity | ≥97 (HPLC) |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 232-233 °C(lit.) |
| Melting Point | 29-31 °C(lit.) |
| Appearance | powder |
| Water Solubility | 0.201 g/100 mL (15 ºC) |
| Application | Flomoxef is an oxacycline antibiotic with good antibacterial activity against a variety of Gram-positive bacteria. |
| PubChem ID | 8189994 |
| SMILES | COC1(NC(=O)CSC(F)F)C(=O)N2C(C(=O)O)=C(CSc3nnnn3CCO)COC21 |
| InChI | InChI=1S/C15H18F2N6O7S2/c1-29-15(18-8(25)6-31-13(16)17)11(28)23-9(10(26)27)7(4-30-12(15)23)5-32-14-19-20-21-22(14)2-3-24/h12-13,24H,2-6H2,1H3,(H,18,25)(H,26,27)/t12-,15+/m1/s1 |
| InChI Key | UHRBTBZOWWGKMK-DOMZBBRYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/49651_1_99665_00_6.pdf |
| Transport Info | Product name: Flomoxef |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Amino-2-methyl-6-benzothiazolol | 99584-08-4 | 2A-9049635 |
| 3-Chloro-N-(3-chlorophenyl)propanamide | 99585-98-5 | 2A-9049636 |
| 3,12-Bis[2-[(acetyloxy)methoxy]-2-oxoethyl]-6,9-dioxa-3,12-diazatetradecanedioic acid 1,14-bis[(acetyloxy)methyl] ester | 99590-86-0 | 2A-9049638 |
| Sertaconazole nitrate | 99592-39-9 | 2A-9049641 |
| carbazol-4-one hydrochloride | 99614-70-7 | 2A-9049645 |
| [60]Fullerene | 99685-96-8 | 2A-9049652 |
| Tropenol hydrochloride | 99709-24-7 | 2A-9049654 |
| 4-Vinylbenzocyclobutene | 99717-87-0 | 2A-9049655 |
| Azetidin-2-ylmethylcarbamic acid tert-butyl ester | 99724-21-7 | 2A-9049657 |
| 2-Fluoro-5-bromobenzyl bromide | 99725-12-9 | 2A-9049658 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA