
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 98700-53-9 |
| Catalog No. | 2A-9049539 |
| Chinese Name | 1,5-二苯基-1H-吡唑-4-羧酸 |
| Synonyms | 1,5-Diphenyl-1H-pyrazol-4-carbonsaeure; 1,5-diphenyl-1H-pyrazole-4-carboxylic acid; HMS2334P07 |
| Molecular Formula | C16H12O2N2 |
| Molecular Weight | 264.28 |
| Purity | 98.00 |
| Density | 1.23 g/cm3 |
| Boiling Point | 451.4ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933199090 |
| PubChem ID | 5420235 |
| MDL Number | MFCD02186759 |
| SMILES | O=C(O)c1cnn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C16H12N2O2/c19-16(20)14-11-17-18(13-9-5-2-6-10-13)15(14)12-7-3-1-4-8-12/h1-11H,(H,19,20) |
| InChI Key | XFYHUVOWHZCRFB-UHFFFAOYSA-N |
| MSDS | msds/49539_1_98700_53_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-(4-Hydroxyphenyl)-1,2,4-triazole | 98581-86-3 | 2A-9049523 |
| Propyl 6-aminopyridazine-3-carboxylate | 98594-47-9 | 2A-9049525 |
| 4-Bromoindole-3-carboxaldehyde | 98600-34-1 | 2A-9049526 |
| N-Methyl-1H-indole-5-ethanesulfonamide | 98623-50-8 | 2A-9049530 |
| 2-Chloro-3-cyano-4-methoxypyridine | 98645-43-3 | 2A-9049534 |
| 3-Amino-5-bromo-2-hydroxypyridine | 98786-86-8 | 2A-9049551 |
| 1-(Cyanomethyl)imidazole | 98873-55-3 | 2A-9049557 |
| 2-Amino-4,5,6,7-tetrahydro-7-oxobenzo[b]thiophene-3-carbonitrile | 98899-30-0 | 2A-9049559 |
| 6-Bromo-4-hydroxyquinoline-3-carboxylic acid | 98948-95-9 | 2A-9049564 |
| N,N-Diemthyl-1-piperazinesulfonamide | 98961-97-8 | 2A-9049566 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA