
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86945-25-7 |
| Catalog No. | 2A-9049419 |
| Chinese Name | 4-(2-氨基乙基)-1-苄基哌啶 |
| Synonyms | MFCD02093423; 2-(1-benzylpiperidin-4-yl)ethanamine |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 |
| Purity | 98.00 |
| Density | 0,99 g/cm3 |
| Boiling Point | 319.4ºC at 760 mmHg |
| Appearance | Liquid;Colorless to Light yellow clear liquid |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2933399090 |
| PubChem ID | 7183697 |
| MDL Number | MFCD02093423 |
| SMILES | NCCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H22N2/c15-9-6-13-7-10-16(11-8-13)12-14-4-2-1-3-5-14/h1-5,13H,6-12,15H2 |
| InChI Key | OUYRPOHWEJUTCQ-UHFFFAOYSA-N |
| MSDS | msds/49419_1_86945_25_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(Pivaloylamino)pyridine | 86847-59-8 | 2A-9049409 |
| 4-[(2,2-Dimethylpropanoyl)amino]pyridine-3-carboxaldehyde | 86847-71-4 | 2A-9049411 |
| 2-Cyano-5-hydroxypyridine | 86869-14-9 | 2A-9049414 |
| 5-Chloropyridine-2-carboxylic acid | 86873-60-1 | 2A-9049415 |
| 2-(Tetrahydrofuran-2-yl)-1H-benzoimidazole | 86932-94-7 | 2A-9049418 |
| 1-Benzyl-4-cyanomethylpiperidine-4-carbonitrile | 86945-27-9 | 2A-9049420 |
| 6-Chloro-5-nitroquinoline | 86984-32-9 | 2A-9049423 |
| trans-1-Cinnamylpiperazine | 87179-40-6 | 2A-9049436 |
| 5-Sulfo-2-furancarboxylic acid | 87299-57-8 | 2A-9049457 |
| Ethyl 2-methyl-1H-imidazole-4-carboxylate | 87326-25-8 | 2A-9049460 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA