CAS Number86867-62-1
Synonyms(E)-2-(2-ethoxycarbonylethenyl)benzaldehyde; ethyl formylcinnamate; 3-(2-formylphenyl)-2(E)-propenoic acid ethyl ester; 2-[(E)-2-(ethoxycarbonyl)ethenyl]benzaldehyde; ETHYL 2-FORMYLCINNAMATE; (E)-3-(2-formylphenyl)propenoic acid ethyl ester; (E)-3-(2-formylphenyl)ethyl acrylate; 2-Propenoic acid,3-(2-formylphenyl)-,ethyl ester; (E)-ethyl 3-(2-formylphenyl) acrylate
Molecular FormulaC12H12O3
Molecular Weight204.22200
Purity98.00%
Density1.144 g/cm3
Boiling Point341.421ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86867-62-1 |
| Catalog No. | 2A-9049413 |
| Chinese Name | 邻甲酰基肉桂酸乙酯 |
| Synonyms | (E)-2-(2-ethoxycarbonylethenyl)benzaldehyde; ethyl formylcinnamate; 3-(2-formylphenyl)-2(E)-propenoic acid ethyl ester; 2-[(E)-2-(ethoxycarbonyl)ethenyl]benzaldehyde; ETHYL 2-FORMYLCINNAMATE; (E)-3-(2-formylphenyl)propenoic acid ethyl ester; (E)-3-(2-formylphenyl)ethyl acrylate; 2-Propenoic acid,3-(2-formylphenyl)-,ethyl ester; (E)-ethyl 3-(2-formylphenyl) acrylate |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22200 |
| Purity | 98.00 |
| Density | 1.144 g/cm3 |
| Boiling Point | 341.421ºC at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 14993480 |
| SMILES | CCOC(=O)C=Cc1ccccc1C=O |
| InChI | InChI=1S/C12H12O3/c1-2-15-12(14)8-7-10-5-3-4-6-11(10)9-13/h3-9H,2H2,1H3/b8-7+ |
| InChI Key | YTQRPRCIESSITI-BQYQJAHWSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CRF (human and rat) | 86784-80-7 | 2A-9049403 |
| 1-(3-Acetylphenyl)-2-thiourea | 86801-04-9 | 2A-9049404 |
| Rhodiosin | 86831-54-1 | 2A-9049408 |
| N-(3-Formyl-2-pyridinyl)-2,2-dimethylpropanamide | 86847-64-5 | 2A-9049410 |
| N-(6-Chloropyridin-2-yl)-2,2-dimethylpropionamide | 86847-84-9 | 2A-9049412 |
| 2-Methyl-2,3-epoxy-1-propanol | 86884-89-1 | 2A-9049416 |
| Quinagolide | 87056-78-8 | 2A-9049427 |
| 3-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]propane-1,2-diol | 87061-04-9 | 2A-9049428 |
| 4-(1,3-Oxazol-5-yl)benzonitrile | 87150-13-8 | 2A-9049435 |
| D-Propargylglycine | 87205-47-8 | 2A-9049442 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS