
CAS Number86695-06-9
Synonyms(2R)-2-Amino-3-methyl-1,1-diphenyl-1-butanol; (r)-(+)-2-amino-3-methyl-1,1-diphenyl-1-butanol; MFCD01318247; (2R)-2-Amino-3-methyl-1,1-diphenylbutan-1-ol
Molecular Formula(CH3)2CHCH(NH2)CH2OH
Molecular Weight103.16
Purity98%
Density1.1±0.1 g/cm3
Boiling Point424.7±40.0 °C at 760 mmHg
Melting Point35-36 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86695-06-9 |
| Catalog No. | 2A-9049391 |
| Chinese Name | (R)-(+)-2-氨基-3-甲基-1,1-二苯基-1-丁醇 |
| Synonyms | (2R)-2-Amino-3-methyl-1,1-diphenyl-1-butanol; (r)-(+)-2-amino-3-methyl-1,1-diphenyl-1-butanol; MFCD01318247; (2R)-2-Amino-3-methyl-1,1-diphenylbutan-1-ol |
| Molecular Formula | (CH3)2CHCH(NH2)CH2OH |
| Molecular Weight | 103.16 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 424.7±40.0 °C at 760 mmHg |
| Melting Point | 35-36 °C (lit.) |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2922199090 |
| PubChem ID | 24857159 |
| MDL Number | MFCD00064297 |
| SMILES | CC(C)[C@@H](N)CO |
| InChI | 1S/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3/t5-/m0/s1 |
| InChI Key | NWYYWIJOWOLJNR-YFKPBYRVSA-N |
| Beilstein/REAXYS | 1719138 |
| NACRES Code | NA.22 |
| UNSPSC | 12352116 |
| MSDS | msds/49391_1_86695_06_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards (R)-(+)-2-amino-3-methyl-1,1-diphenyl-1-butanol Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-2-Amino-3-methoxypropanoic acid hydrochloride | 86118-10-7 | 2A-9049321 |
| (R)-2-Amino-3-methoxylpropanoic acid | 86118-11-8 | 2A-9049322 |
| 3-Fluoro-4-nitrobenzenesulfonyl chloride | 86156-93-6 | 2A-9049328 |
| Ethyl 2-(2-aminothiazole-4-yl)-2-(1-tert-butoxycarbonyl-1-methylethoxyimino)acetate | 86299-46-9 | 2A-9049341 |
| (S)-tert-Butyl 2-(tosyloxymethyl)pyrrolidine-1-carboxylate | 86661-32-7 | 2A-9049388 |
| (S)-Methyl 4-cloro-3-hydroxybutyrate | 86728-93-0 | 2A-9049396 |
| 3-Benzyl-3,7-diazabicyclo[3.3.0]octane | 86732-22-1 | 2A-9049397 |
| N-Cbz-3-piperidineacetic acid methyl ester | 86827-08-9 | 2A-9049406 |
| N-Cbz-3-piperidineacetic acid | 86827-10-3 | 2A-9049407 |
| 1-Boc-Pyrrolidine | 86953-79-9 | 2A-9049421 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA