
CAS Number85137-09-3
Synonyms4-ethoxybenzene-1,2-diamine,sulfuric acid; 4-Ethoxybenzene-1,2-diamine sulfate (1:1); 4-Ethoxy-1,2-benzenediamine sulfate (1:1); 1,2-Benzenediamine, 4-ethoxy-, sulfate (1:1); MFCD00640896; EINECS 214-825-0
Molecular FormulaC8H12O1N2
Molecular Weight152.2
Purity98.00%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85137-09-3 |
| Catalog No. | 2A-9049199 |
| Chinese Name | 3,4-二氨基苯乙醚硫酸盐 |
| Synonyms | 4-ethoxybenzene-1,2-diamine,sulfuric acid; 4-Ethoxybenzene-1,2-diamine sulfate (1:1); 4-Ethoxy-1,2-benzenediamine sulfate (1:1); 1,2-Benzenediamine, 4-ethoxy-, sulfate (1:1); MFCD00640896; EINECS 214-825-0 |
| Molecular Formula | C8H12O1N2 |
| Molecular Weight | 152.2 |
| Purity | 98.00 |
| HTC | 2922299090 |
| PubChem ID | 46980055 |
| MDL Number | MFCD00640896 |
| SMILES | CCOc1ccc(N)c(N)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H12N2O.H2O4S/c1-2-11-6-3-4-7(9)8(10)5-6;1-5(2,3)4/h3-5H,2,9-10H2,1H3;(H2,1,2,3,4) |
| InChI Key | AOWLQOMCVRWFEA-UHFFFAOYSA-N |
| MSDS | msds/49199_1_85137_09_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Butyl-3-methylimidazolium bromide | 85100-77-2 | 2A-9049183 |
| (-)-Diisopinocampheyl chloroborane | 85116-37-6 | 2A-9049188 |
| WCA-80 | 35430-88-7 | 2A-9049190 |
| 3,4-Difluorobenzyl alcohol | 85118-05-4 | 2A-9049193 |
| (-)-B-Methoxydiisopinocampheylborane | 85134-98-1 | 2A-9049197 |
| Methyl 4-chloro-3-methoxy-2-(E)-butenoate | 85153-60-2 | 2A-9049201 |
| 3-(3-Chloropropyl)-1,3-dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one | 85175-59-3 | 2A-9049203 |
| Driselase | 85186-71-6 | 2A-9049204 |
| Eucalyptus citriodora oil | 85203-56-1 | 2A-9049206 |
| Sodium 2,2'-methylene-bis-(4,6-di-tert-butylphenyl)phosphate | 85209-91-2 | 2A-9049207 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA