
CAS Number85068-35-5
SynonymsEINECS 285-297-7; (2,4-difluorophenyl)-phenylmethanone; MFCD00000331
Molecular FormulaC13H8F2O
Molecular Weight218.19900
Purity98.00%
Density1.261 g/mL at 25 °C(lit.)
Boiling Point120 °C (2 mmHg)
Melting Point33°C
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85068-35-5 |
| Catalog No. | 2A-9049170 |
| Chinese Name | 2,4-二氟二苯甲酮 |
| Synonyms | EINECS 285-297-7; (2,4-difluorophenyl)-phenylmethanone; MFCD00000331 |
| Molecular Formula | C13H8F2O |
| Molecular Weight | 218.19900 |
| Purity | 98.00 |
| Density | 1.261 g/mL at 25 °C(lit.) |
| Boiling Point | 120 °C (2 mmHg) |
| Melting Point | 33°C |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Sealed, cool, dry place |
| HTC | 2914700090 |
| PubChem ID | 3152039 |
| SMILES | O=C(c1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H8F2O/c14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h1-8H |
| InChI Key | FRHMSTHFVFIPCO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Diethyl-9H-thioxanthen-9-one | 82799-44-8 | 2A-9048807 |
| 2,4-Dibromobutyryl chloride | 82820-87-9 | 2A-9048809 |
| Bifenthrin | 83322-02-5 | 2A-9048875 |
| 2-(2,4-Dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane | 83833-32-3 | 2A-9048938 |
| 2,4-Dihydroxypyridine | 84719-31-3 | 2A-9049108 |
| 2,4-Diethyl-2,6-heptadienal | 85136-07-8 | 2A-9049198 |
| Primisulfuron-methyl | 86209-51-0 | 2A-9049335 |
| 2-[[(2,4-Difluorophenyl)-2-oxiranyl]methyl]-1H-1,2,4-triazole methanesulfonate | 86386-77-8 | 2A-9049351 |
| 3,5-Dimethylpyrrole-2,4-dicarboxylic acid 2-t-butyl ester-4-ethyl ester | 86770-31-2 | 2A-9049401 |
| Haloxyfop-etotyl | 87237-48-7 | 2A-9049449 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA