
CAS Number84989-04-8
SynonymsEinecs 284-892-9; 2-hydroxy-1-methylbenzene; hydroxytoluene; o-Cresol [UN2076] [Poison, Corrosive]; 2-cresol; para-cresol; 2-hydroxytoluene; TRICRESOL; METHYLPHENOL TRICRESOL; cresylic acid; Monomethyl phenol; EINECS 215-293-2; o-Methylphenol; ortho-cresol; o-Cresol; MFCD00151099; o-Hydroxytoluene; Cresol, o-isomer; M,P-CRESOL
Molecular FormulaC14H16O2
Molecular Weight382.43
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point191.0±0.0 °C at 760 mmHg
Melting Point66-68ºC
AppearanceColorless or yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84989-04-8 |
| Catalog No. | 2A-9049150 |
| Chinese Name | 间对甲酚 |
| Synonyms | Einecs 284-892-9; 2-hydroxy-1-methylbenzene; hydroxytoluene; o-Cresol [UN2076] [Poison, Corrosive]; 2-cresol; para-cresol; 2-hydroxytoluene; TRICRESOL; METHYLPHENOL TRICRESOL; cresylic acid; Monomethyl phenol; EINECS 215-293-2; o-Methylphenol; ortho-cresol; o-Cresol; MFCD00151099; o-Hydroxytoluene; Cresol, o-isomer; M,P-CRESOL |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 382.43 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 191.0±0.0 °C at 760 mmHg |
| Melting Point | 66-68ºC |
| Appearance | Colorless or yellow liquid |
| Storage Condition | Store in a cool, ventilated place, and store and t |
| HTC | 2707991000 |
| PubChem ID | 37255824 |
| SMILES | Cc1ccc(O)cc1.Cc1cccc(O)c1 |
| InChI | InChI=1S/2C7H8O/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6/h2*2-5,8H,1H3 |
| InChI Key | PHVAHRJIUQBTHJ-UHFFFAOYSA-N |
| Transport Info | Product name: m-p-cresol |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Guarana | 84929-28-2 | 2A-9049137 |
| Lemon Extract | 84929-31-7 | 2A-9049138 |
| Rosavin | 84954-92-7 | 2A-9049143 |
| Rosarin | 84954-93-8 | 2A-9049144 |
| Cefquinome | 84957-30-2 | 2A-9049147 |
| 2-Oxetanone 3-C12-16-alkyl-4-C13-17-alkylidene derivatives | 84989-41-3 | 2A-9049151 |
| 5-Hydroxypentanoic acid cyclohexylamide | 84996-93-0 | 2A-9049153 |
| 4-Propylphenyl 4-(trans-4-pentylcyclohexyl)benzoate | 85005-66-9 | 2A-9049154 |
| 2-Chloro-5-methoxyaniline hydrochloride | 85006-21-9 | 2A-9049155 |
| Lithium bromide | 85017-82-9 | 2A-9049159 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA