
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84682-27-9 |
| Catalog No. | 2A-9049101 |
| Chinese Name | 1-(对甲苯基)-1-环己甲酸 |
| Synonyms | 1-(4-methylphenyl)cyclohexane-1-carboxylic acid |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.298 |
| Purity | 98.00 |
| Density | 1.104 g/cm3 |
| Boiling Point | 370.7ºC at 760 mmHg |
| Melting Point | 166-170ºC |
| Appearance | White to beige powder |
| Storage Condition | room temperature |
| HTC | 2916399090 |
| PubChem ID | 435569 |
| MDL Number | MFCD00065264 |
| SMILES | Cc1ccc(C2(C(=O)O)CCCCC2)cc1 |
| InChI | InChI=1S/C14H18O2/c1-11-5-7-12(8-6-11)14(13(15)16)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3,(H,15,16) |
| InChI Key | BEVYUARQHKRBMH-UHFFFAOYSA-N |
| MSDS | msds/49101_1_84682_27_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Chloro-5-fluorobenzaldehyde | 84194-30-9 | 2A-9049007 |
| 2-[4-(Trifluoromethyl)phenyl]benzaldehyde | 84392-23-4 | 2A-9049033 |
| N-((4-Chloromethyl)-2-thiozolyl)guanidine hydrochloride | 84545-70-0 | 2A-9049066 |
| Dimethyl 3-Cyclopentene-1,1-dicarboxylate | 84646-68-4 | 2A-9049092 |
| 1-(Cbz-amino)cyclopropanecarboxylic acid | 84677-06-5 | 2A-9049098 |
| 5-(1-Pyrrolidino)-2-furaldehyde | 84966-28-9 | 2A-9049148 |
| trans-4-Ethyl-(1,1-bicyclohexyl)-4-carboxylic acid | 84976-67-0 | 2A-9049149 |
| 3-Aminophenylboronic acid hydrochloride | 85006-23-1 | 2A-0201170 |
| 3,5-Bis(trifluoromethyl)benzylamine | 85068-29-7 | 2A-9049166 |
| 4-Carboxy-2-nitrophenylboronic acid | 85107-54-6 | 2A-9049185 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA