
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84627-04-3 |
| Catalog No. | 2A-9049088 |
| Chinese Name | 芬地柞酸 |
| Synonyms | fendizoate; Fendizoic acid; 2-[(6-Hydroxy-3-biphenylyl)carbonyl]benzoic acid |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.33 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 593.9±50.0 °C at 760 mmHg |
| Melting Point | 262-264ºC |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 14899197 |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H14O4/c21-18-11-10-14(12-17(18)13-6-2-1-3-7-13)19(22)15-8-4-5-9-16(15)20(23)24/h1-12,21H,(H,23,24) |
| InChI Key | PKHPZNKXOBWFCX-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Lonicera caprifolium extract | 84603-62-3 | 2A-9049077 |
| Rose Hip Oil | 84603-93-0 | 2A-9049078 |
| Rosemary extract | 84604-14-8 | 2A-9049079 |
| Saw Palmetto extract | 84604-15-9 | 2A-0201809 |
| Milk Thistle Extract | 84604-20-6 | 2A-9049081 |
| 9-Chloro-2-methyl-5H-pyrazolo[1,5-d][1,4]benzodiazepin-6(7H)-one | 84661-23-4 | 2A-9049094 |
| 4-(Hexadecylamino)benzylamine | 84670-96-2 | 2A-9049096 |
| 1,1'-Bis(di-tert-butylphosphino)ferrocene | 84680-95-5 | 2A-9049100 |
| Ginger extract | 84696-15-1 | 2A-9049105 |
| Hydrocotyle asiatica extract | 84696-21-9 | 2A-9049106 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA